EuPSIC is a manually curated and continuously updated database of small molecules that have been shown in the literature to specifically inhibit eukaryotic translation in vivo or in vitro. The compounds are divided into three groups depending on their targets and are further classified according to structural and mechanistic features. Users are encouraged to search through the tables or download information in their preferred format.
| SC | Name | Pubchem CIDs | Class, group of chemical compounds | MW | Domain specifi- city (BAE) |
Ribosomal subunit | Binding site | Stage affected | Mechanism of action | Effect on polysomes | Comments | References | Clinical trials | Cost and Vendors | PDB structures |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 5 | 253602 |
pyrrolidine, anisomycin group
|
265 | AE | 60S | PTC (A) | E | S |
causes ribotoxic stress; shows the amino acid specificity
|
NA | from 44$ |
{3CC4 - archaea}, {4U3M - yeasts}
|
|||
| 6 | 11790817 |
pyrrolidine, anisomycin group
|
223 | E | 60S | PTC (A) | E? | S? |
less effective than anisomycin, but does not cause ribotoxic stress
|
10318810 | NA | from 321$ | NA | ||
| 124 | 3081195 |
pyrrolidine, anisomycin group
|
318 | E | 60S | PTC (A)? | E? | NA | NA | NA | NA | NA | |||
| 99 | neosolaniol | 13818797 |
trichothecene A
|
382 | E | 60S? | PTC (A)? | E? | NA | NA | 3824405 | NA | from 222$ |
{4U6F - yeasts}
|
|
| 102 | HT-2 toxin | 10093830 |
trichothecene A
|
424 | E | 60S | PTC (A)? | E? | NA | 3824405 | NA | from 303$ | NA | ||
| 93 | 107974 |
trichothecene А
|
264 | BAE | 60S? | PTC (A)? | E? | S/D | 856003 | NA | NA |
{4U53 - yeasts}
|
|||
| 100 | acetyl T-2 | 546103 |
trichothecene A
|
509 | E | 60S? | PTC (A)? | E? | NA | NA | 3824405 | NA | NA |
{4U6F - yeasts}
|
|
| 96 | 14218252 |
trichothecene A
|
350 | E | 60S? | PTC (A)? | E? | NA | NA | DOI DOI |
NA | NA | NA | ||
| 98 | 91518 |
trichothecene A
|
366 | BAE | 60S | PTC (A) |
E (early stages)
|
D |
irreversible inhibitors slightly inhibits rna synthesis
|
NA | NA | NA | |||
| 95 | trichodermin | 20806 |
trichothecene A
|
292 | E | 60S | PTC | E | PTC inhibitor | S/D | NA | NA | NA | ||
| 94 | trichodermol | 12315016 |
trichothecene A
|
250 | E | 60S | PTC | E | PTC inhibitor | S | NA | NA | NA | ||
| 101 | T-2 toxin | 5284461 |
trichothecene A
|
467 | E | 60S | PTC (A) |
E (early stages)
|
D | NA | from 74$ |
{4U6F - yeasts}
|
|||
| 103 | T-2 triol | 13797589 |
trichothecene A
|
382 | E | 60S? | PTC (A)? | E? | NA |
strong inducer of apoptosis; can activate the stress-activated kinases c-Jun
N-terminal kinase 1 (JNK1) and/or p38MAPK (SAPK2)
|
3824405 | NA | from 306$ |
{4U6F - yeasts}
|
|
| 97 | calonectrin | 11473563 |
trichothecene A
|
350 | NA | 60S? | PTC (A)? | E | PTC inhibitor | S/D | NA | NA | NA | NA | |
| 104 | scirpentriol | 73495 |
trichothecene A
|
282 | BAE | 60S | PTC (A) | E | PTC inhibitor | S | NA | 3824405 | NA | NA | NA |
| 87 |
15-acetyldeoxynivalenol / 15-ADON
|
10382483 |
trichothecene B
|
338 | E | 60S? | PTC (A)? | E? | NA | NA | 22859312 | NA | NA | NA | |
| 88 | 40024 |
trichothecene B
|
296 | E | 60S | PTC (A) | E | PTC inhibitor | D | NA | NA | from 63$ |
{4U53 - yeasts}
|
||
| 89 | nivalenol | 5284433 |
trichothecene B
|
312 | E | 60S? | PTC (A)? | E? | D |
causes ribotoxic stress
|
4521056 | NA | from 170$ |
{4U53 - yeasts}
|
|
| 92 | trichothecin | 12444502 |
trichothecene B
|
332 | E | 60S | PTC (A)? | E | PTC inhibitor | S/D | NA | NA | NA | NA | |
| 90 | 304599 |
trichothecene B
|
354 | E | 60S | PTC | E | S/d |
does not penetrate into the yeast cells
|
NA | from 57$ |
{4U53 - yeasts}
|
|||
| 91 | crotocin | 6437832 |
trichothecene С
|
332 | E | 60S | PTC (A) | E, T? | S |
reversible inhibitor
|
999905 | NA | NA | NA | |
| 53 | roridin A | 9915017 |
trichothecene D
|
533 | E | 60S? | PTC (A)? | E? | NA | NA | 3376149 | NA | NA |
{4U50 - yeasts}
|
|
| 52 | satratoxin G | 23305158 |
trichothecene D
|
545 | E |
60S (28S)
40S |
PTC (A) | E? | D |
reversible binding to a ribosome
|
19306889 | NA | NA |
{4U50 - yeasts}
|
|
| NA | NA |
trichothecene D derivative
|
NA | E | NA | PTC (A)? | E? | NA |
noval molecule, poorly studied
|
22806769 | NA | ? | NA | ||
| 54 | 6326658 |
trichothecene D, muconomycin
|
NA | E | 60S | PTC (A) |
E (early stages)
|
PTC inhibitor | S/d |
irreversible inhibitor
|
NA | NA |
{4U50 - yeasts}
|
||
| 55 | 23305159 |
trichothecene D, muconomycin
|
485 | E | 60S? | PTC (A)? | E? | PTC inhibitor | S/d | NA | NA | NA | NA | ||
| 50 | 11049880 |
trichothecene D, muconomycin
|
NA | E | 60S? | PTC (A)? | E? | NA |
noval molecule, poorly studied
|
22806769 | NA | NA | NA | ||
| 175 | 443670 |
tetraheterocyclic alkaloid
|
287 | E | 60S | PTC (A) | E | PTC inhibitor | (S) | NA | NA | NA | NA | ||
| 170 | 443678 |
tetraheterocyclic alkaloid
|
317 | AE | 60S | PTC (A) | E | (S) | NA | NA | NA |
{5ON6 - yeasts}
|
|||
| 172 | jonquailine | 271607 |
tetraheterocyclic alkaloid
|
345 | E? | 60S? | PTC (A)? | E? | NA | 25598189 | NA | NA | NA | ||
| 227 | 5479394 |
tetraheterocyclic alkaloid
|
307 | BAE? | 60S? | PTC (A)? | E? | PTC inhibitor | S | NA | NA | NA | NA | ||
| 174 | crinamine | 73620 |
tetraheterocyclic alkaloid
|
301 | BAE | 60S | PTC (A) | E | (S) | NA | NA | NA | |||
| 228 | narciclasine | 72376 |
tetraheterocyclic alkaloid
|
293 | BAE | 60S | PTC (A) | E | S | NA | NA | from 121$ |
{4U51 - yeasts}
|
||
| 171 | pretazettine | 73360 |
tetraheterocyclic alkaloid
|
331 | E | 60S | PTC (A) | E | S | NA | NA | NA | NA | ||
| 229 | 101204 |
tetraheterocyclic alkaloid
|
309 | BAE? | 60S? | PTC (A)? | E? | PTC inhibitor | S? | NA | NA | NA | NA | ||
| NA | NA |
tetraheterocyclic alkaloid
|
NA | BAE? | 60S? | PTC (A)? | E? | PTC inhibitor | S? | NA | NA | ? | NA | ||
| 173 | 441593 |
tetraheterocyclic alkaloid
|
301 | AE | 60S | PTC (A) | E | S | 29429877 | NA | NA |
{5ON6 - yeasts}
|
|||
| 166 | 10429288 |
tetraheterocyclic alkaloid
|
371 | BAE | 60S | PTC (A) | E | PTC inhibitor | NA | NA | NA | NA | NA | ||
| 169 | 11876135 |
tetraheterocyclic alkaloid
|
289 | BAE | 60S | PTC (A) | E | PTC inhibitor | NA | NA | NA | from 88$ | NA | ||
| 168 | lycorine | 72378 |
tetraheterocyclic alkaloid
|
287 | BAE | 60S | PTC (A) | E | PTC inhibitor | NA |
small effect on yeasts?
|
NA | from 23$ | NA | |
| 167 | 443689 |
tetraheterocyclic alkaloid
|
289 | BAE | 60S | PTC (A) | E | PTC inhibitor | NA | NA | NA | from 463$ |
{4U4U - yeasts}
|
||
| 4 | agelastatin A | 177936 | 341 | E | 60S | PTC (A) | E | PTC inhibitor | NA | NA | 28457705 | NA | NA |
{5MEI - yeasts}
|
|
| 178 |
homoharringtonine / omacetaxine
mepesuccinate
|
285033 | 546 | AE | 60S | PTC (A) |
E (early stages)
|
PTC inhibitor | D |
used in the treatment of acute leukemia
|
from 50$ |
{3G6E - archaea}, {4U4Q - yeasts}, {6EK0 - humans}, {6QZP - humans}
|
|||
| 177 | 276389 | 532 | AE | 60S | PTC (A) |
E (early stages)
|
PTC inhibitor | D |
shows the amino acid specificity
|
NA | from 57$ |
{3G6E - archaea}, {4U4Q - yeasts}, {6EK0 - humans}, {6QZP - humans}
|
|||
| 176 | 65305 | 315 | (E) | 60S | PTC (A)? | (E)? | (S) |
showing minimal activity
|
8 USA | from 50$ | NA | ||||
| 125 | 15816477 | 527 | E | NA | NA | NA | NA | NA | NA | link DOI link |
NA | NA | NA | ||
| 39 | amikacin | 37768 |
aminoglycoside
|
586 | BE | 40S | DC | E, T | D | NA | from 30$ |
{2F4V - bacteria}, {4P20 - bacteria}, {6YPU - bacteria}
|
|||
| 40 |
guanidino-tobramycin
|
482108 |
aminoglycoside
|
678 | BE? | 40S [30S] |
18S (А)?
[16S]? |
E?, T? | D? | NA | NA | NA | NA | NA | |
| 231 |
nagilactone C
|
72505 | diterpenoid | 362 | E | 60S | PTC (A) | E | D |
another activity is a stop-codon-independent ribosome dissociation
|
NA | from 463$ |
{4U52 - yeasts}
|
||
| 232 |
nagilactone E
|
72504 | diterpenoid | 348 | E | 60S? | PTC (A)? | E? | NA |
molecular docking discovered a RIOK2 protein (atypical kinases that are
related to the ribosome maturation process) as a potential targets on
nagilactone E
|
32047261 | NA | NA | NA | |
| 72 |
hydrysedisobrucein-B
|
NA | quassinoid | NA | NA | NA | NA | NA | NA | NA |
SMILES:
O=C1OC([C@]2(CO3)C4C(O)[C@@H](O)[C@]3(C(OC)=O)C2[C@H]1C)CC([C@]4(C)C5O)C(C)=CC5=O
|
23484873 | NA | NA | NA |
| 62 |
11-acetylamarolide
|
460540 | quassinoid | 407 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 76 |
15-hydroxyklaineanone
|
21677660 | quassinoid | 545 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 80 |
2-hydroxysimalikalactone D
|
NA | quassinoid | NA | NA | NA | NA | NA | NA | NA |
SMILES:
CCC(C(O[C@@H]1C2[C@@]3(C)[C@H](O)[C@H](O)C4C2(C(OC1=O)CC5[C@]4(C)[C@H](O)[C@H](O)C=C5C)CO3)=O)C
|
15737686 | NA | NA | NA |
| 137 |
2-hydroxysimalikalactone D acetate
|
44559536 | quassinoid | NA | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 71 | ailantinol A | 460536 | quassinoid | 406 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 78 | ailanthinone | 441784 | quassinoid | 479 | E | 60S? | PTC (A)? | NA | PTC inhibitor | NA |
the mechanism of action is not fully understood, it is assumed that it
violates the normal functions of the ribosome; antimalarial was activity
detected
|
2198027 | NA | NA | NA |
| 85 | ailanthone | 72965 | quassinoid | 376 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | from 48$ | NA |
| 51 | baccharinol | 6436238 | quassinoid | 563 | E | 60S? | PTC (A)? | E? | NA |
the mechanism of action of baccharinol has not been
reported, but it is a trichothecin epoxide that
likely inhibits elongation
|
14769948 | NA | NA | NA | |
| 142 | brusatol | 73432 | quassinoid | 521 | E | 60S? | PTC (A) | E? | NA | NA | from 43$ |
{3G71 - archaea}
|
|||
| 143 | bruceantin | 5281304 | quassinoid | 549 | AE | 60S | PTC (A) | E | NA | NA | from 121$ |
{3G71 - archaea}
|
|||
| 74 | brucein D | 432922 | quassinoid | 410 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 81 | brucein E | 122785 | quassinoid | 412 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 162 | bruceanol A | 127805 | quassinoid | 543 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 129 | bruceanol B | 14060344 | quassinoid | 537 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 131 | bruceanol D | 70697724 | quassinoid | 549 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA |
{3G71 - archaea}
|
| 132 | bruceanol E | 9985020 | quassinoid | 551 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 133 | bruceanol H | 10745249 | quassinoid | 551 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 157 | 6436226 | quassinoid | 711 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA | |
| 146 | 6474271 | quassinoid | 711 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA | |
| 150 | 6436229 | quassinoid | 769 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA | |
| 154 | 441789 | quassinoid | 683 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA | |
| 145 |
bruceoside B
|
3000796 | quassinoid | 683 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 156 |
bruceoside D
|
460525 | quassinoid | 669 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 159 |
bruceoside E
|
460524 | quassinoid | 671 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 151 | bruceoside F | 6451123 | quassinoid | 755 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 155 |
bruceoside G
|
NA | quassinoid | NA | NA | NA | NA | NA | NA | NA |
SMILES:
CC1C2CC3C45COC(C(O)C(O)C5C2(C)C=C(OC6C(O)C(O)C(O)C(CO)O6)C1=O)(C(O)=O)C4C(OC(/C=C(C(C)C)\C)=O)C(O3)=O
|
15737686 | NA | NA | NA |
| 82 | glaucarubol | 225484 | quassinoid | 396 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 75 | 441797 | quassinoid | 394 | NA | NA | NA | NA | NA | NA | NA | 6155912 | NA | NA | NA | |
| 77 | 158475 | quassinoid | 437 | E? | 60S | PTC (A) | NA | PTC inhibitor | NA | NA | NA | NA | NA | ||
| 134 | 54602813 | quassinoid | 477 | E | 60S? | PTC (A)? |
E (early stages)
|
PTC inhibitor | NA | NA | 6927363 | NA | NA | NA | |
| 135 | 54602813 | quassinoid | 603 | E | 60S? | PTC (A)? |
E (early stages)
|
PTC inhibitor | NA | NA | 6927363 | NA | NA | NA | |
| 161 | 315123 | quassinoid | 541 | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | ||
| NA |
dehydrobrucentin
|
NA | quassinoid | NA | NA | NA | NA | NA | NA | NA |
SMILES:
CC1=C(C[C@@H]2[C@]34[C@@H]5[C@@H](O)[C@H](O)[C@](OC4)(C(OC)=O)[C@@H]3[C@@H](OC(/C=C(C(C)C)\C)=O)C(O2)=O)[C@]5(C)C=C(O)C1O |
15737686 | NA | ? | NA |
| 130 | isobrucein B | 99530 | quassinoid | 481 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 69 | quassin | 65571 | quassinoid | 389 | E? | 60S? | PTC (A)? | E? | NA | NA | NA | 15737686 | NA | from 463$ | NA |
| 67 | neoquassin | 72964 | quassinoid | 391 | BAE? | 40S? | DC? | (R?) | NA | NA | 15737686 | NA | NA | NA | |
| 19 |
nigakihemiacetal A
|
441803 | quassinoid | 411 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 18 |
nigakihemiacetal D
|
182704 | quassinoid | 453 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 66 |
nigakihemiacetal E
|
102267540 | quassinoid | 395 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 24 |
nigakihemiacetal F
|
101665330 | quassinoid | 395 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 21 |
nigakihemiacetal L
|
182233 | quassinoid | NA | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 61 | picrasin A | 185611 | quassinoid | 475 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 68 | picrasin B | 12313355 | quassinoid | 376 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | from 463$ | NA |
| 22 | picrasin D | 46173860 | quassinoid | 391 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 23 | picrasin E | 182116 | quassinoid | 407 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| NA | picrasinol C | NA | quassinoid | NA | NA | NA | NA | NA | NA | NA |
SMILES:
O=C1C(OC)=C(C)[C@@]2(O)[C@]3(C)[C@@](OC(C2)=O)([H])C[C@]([C@@]4(C)[C@@]31[H])([H])[C@@H](C)C=C(OC)C4=O |
15737686 | NA | ? | NA |
| 20 | picrasinol D | 101921953 | quassinoid | 409 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| NA |
semalikalactone D 11,12 diacetate
|
NA | quassinoid | NA | NA | NA | NA | NA | NA | NA |
SMILES:
O[C@H]1[C@@]2(C)[C@@](C[C@](O3)([H])[C@]4(CO5)[C@@]2([H])[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@]5(C)[C@]4([H])[C@@H](OC(C(C)CC)=O)C3=O)([H])C(C)=CC1=O |
15737686 | NA | ? | NA |
| 138 | sergeolide | 134025 | quassinoid | 505 | NA | NA | NA | NA | NA | NA |
anti-malarial drug
|
15737686 | NA | NA | NA |
| 79 |
semalikalactone D
|
15161842 | quassinoid | NA | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 84 |
sinjulactone A
|
460537 | quassinoid | NA | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 70 |
sinjulactone B
|
21148461 | quassinoid | NA | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 86 |
sinjulactone C
|
11970132 | quassinoid | NA | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 136 | undulatone | 5281311 | quassinoid | 535 | NA | NA | NA | NA | NA | NA | NA | NA | NA | NA | |
| 83 | chaparrin | 441791 | quassinoid | 380 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 73 | 73154 | quassinoid | 378 | NA | NA | NA | NA | NA | NA | NA | 6155912 | NA | NA | NA | |
| NA | NA | quassinoid | NA | E | NA | NA | E | NA | NA | NA | 6875823 | NA | ? | NA | |
| NA | NA | quassinoid | NA | E | NA | NA | E | NA | NA | NA | NA | ? | NA | ||
| 158 | 72956 | quassinoid | 685 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA | |
| 147 |
yadanzioside B
|
72952 | quassinoid | 701 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 153 |
yadanzioside C
|
6436227 | quassinoid | 727 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| NA |
yadanzioside D
|
SID | quassinoid | NA | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | ? | NA |
| 148 |
yadanzioside E
|
460522 | quassinoid | 685 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 152 |
yadanzioside G
|
6436228 | quassinoid | 769 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 144 |
yadanzioside L
|
6436225 | quassinoid | 727 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 160 |
yadanzioside M
|
72961 | quassinoid | 705 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 149 |
yadanzioside N
|
6451089 | quassinoid | 711 | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | NA | NA |
| 139 | BJF 8 | NA | quassinoid | NA | NA | NA | NA | NA | NA | NA |
SMILES:
C/C(C(F)(F)F)=C\C(O[C@H]1C(O[C@]([C@]2(CO3)[C@]4([H])[C@@H](O)[C@@H](O)[C@]3(C(OC)=O)[C@]12[H])([H])C[C@@]([C@]4(C)C5)([H])C(C)=C(OC(/C=C(C(F)(F)F)/C)=O)C5=O)=O)=O
|
15737686 | NA | NA | NA |
| 141 | BJF 11 | NA | quassinoid | NA | NA | NA | NA | NA | NA | NA |
SMILES:
C/C(C(F)(F)F)=C/C(O[C@H]1C(O[C@]([C@]2(CO3)[C@]4([H])[C@@H](O)[C@@H](O)[C@]3(C(OC)=O)[C@]12[H])([H])C[C@@]([C@]4(C)C5)([H])C(C)=C(O)C5=O)=O)=O
|
15737686 | NA | NA | NA |
| NA |
D13(18)-dehydroglaucarubinone
|
NA | quassinoid | NA | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | ? | NA |
| NA | IBI 5 | NA | quassinoid | NA | NA | NA | NA | NA | NA | NA | NA | 15737686 | NA | ? | NA |
| 140 | IBI 12 | NA | quassinoid | NA | NA | NA | NA | NA | NA | NA |
SMILES:
C/C(C(F)(F)F)=C\C(O[C@H]1C(O[C@]([C@]2(CO3)[C@]4([H])[C@@H](O)[C@@H](O)[C@]3(C(OC)=O)[C@]12[H])([H])C[C@@]([C@]4(C)C5)([H])C(C)=C(O)C5=O)=O)=O
|
15737686 | NA | NA | NA |
| 127 | SUN 0237 | 5458870 | quassinoid | 573 | E | NA | NA | NA | NA | NA | NA | 14769948 | NA | NA | NA |
| 128 | SUN 2071 | 5458871 | quassinoid | 545 | E? | NA | NA | NA | NA | NA | NA | NA | NA | NA | |
| 217 | 6438494 | 345 | E | 60S | PTC (A, P)? | NA | NA | NA | 2014963 | NA | NA | NA | |||
| 121 | 9576961 | NA | E | 60S? | PTC (A, P)? | NA | NA |
the cytostatic activity of sparsomycin seems to be
related to its lipophilicity: octylsparsomycin was shown to be
three times as effective as sparsomycin
|
2014963 | NA | NA | NA | |||
| 219 | sparsomycin | 9543443 | 361 | BAE | 60S | PTC (A, P) | Е | PTC inhibitor | S | NA | from 235$ |
{1M90 - archaea}, {1NJM - bacteria}, {1NJN - bacteria}, {1VQ8 - archaea},
{1VQ9 - archaea}, {5DGE - yeasts}, {5DGF - yeasts}, {5DGV - yeasts}, {5TGM -
yeasts}
|
|||
| 189 | 9578328 | 377 | BAE | 60S? | PTC (A,P)? | NA | NA |
believed to be a more effective anti-tumor agent than sparsomycin
itself
reversible inhibitor; binding experiments indicated that sparsomycin and its derivatives are fully competitive in their interaction with the ribosome |
2014963 | NA | NA | NA | |||
| 218 | 6436444 | 360 | E | 60S? | PTC (A, P)? | NA | NA | NA | 2014963 | NA | NA |
{1M90 - archaea}, {1NJM - bacteria}, {1NJN - bacteria}, {1VQ8 - archaea},
{1VQ9 - archaea}, {5DGE - yeasts}, {5DGF - yeasts}, {5DGV - yeasts}, {5TGM -
yeasts}
|
|||
| 187 | MDL 19152 | 6105995 | NA | E | 60S | PTC (A, P)? | NA | NA | NA | 2014963 | NA | NA | NA | ||
| 188 | MDL 20828 | 6438817 | 393 | E | 60S | PTC (A, P)? | NA | NA | NA | 2014963 | NA | NA | NA | ||
| 119 | 9576884 | 404 | E | 60S | PTC (A, P)? | NA | NA | NA | 2014963 | NA | NA | NA | |||
| 29 | 66365 | 584 | BAE | 60S | PTC (P) | E | PTC inhibitor | (S) | NA | 371683 | NA | NA | NA | ||
| 164 | amicetin | 28675 |
nucleoside, blasticidin group
|
619 | BAE | 60S | PTC | E | PTC inhibitor | S | NA | 8157007 | NA | NA |
{6CZR - bacteria}
|
| 59 | arginomycin | 129552 |
nucleoside, blasticidin group
|
437 | BAE | 60S? | PTC? | E? | NA | NA | 3610832 | NA | NA |
{1KC8 - archaea}, {4U56 - yeasts}, {4V9Q - yeasts}, {6B4V - yeasts}, {6BOH -
bacteria}
|
|
| 165 | bamicetin | 170723 |
nucleoside, blasticidin group
|
605 | BAE | 60S | PTC | E | PTC inhibitor | NA | NA | 25522318 | NA | NA | NA |
| 58 | blasticidin S | 170012 |
nucleoside, blasticidin group
|
422 | BAE | 60S | PTC (P) | E | PTC inhibitor | NA |
in bacteria, they inhibit elongation and termination, in
eukaryotes-elongation; shows amino acid specificity
|
NA | NA |
{1KC8 - archaea}, {4U56 - yeasts}, {4V9Q - yeasts}, {6B4V - yeasts}, {6BOH -
bacteria}
|
|
| 60 | gougerotin | 11226719 |
nucleoside, blasticidin group
|
443 | BAE | 60S | PTC | E | PTC inhibitor | D | NA | NA | NA | NA | |
| 57 | mildiomycin | 12850205 |
nucleoside, blasticidin group
|
515 | BE | 60S | PTC | E | PTC inhibitor | NA |
antibiotic does not easily pass through the cell membrane, as occurs with
other nucleoside and aminoglycoside antibiotics
|
2409064 | NA | NA | NA |
| 3 | nucleocidin | 72299 |
nucleoside, blasticidin group
|
364 | BE | 60S | PTC | NA | PTC inhibitor | NA |
high active against trypanosomes;
ithere is an in vivo activity; the mechanism is not fully understood; |
NA | NA | NA | NA |
| 163 | plicacetine | 206175 |
nucleoside, blasticidin group
|
518 | BAE | 60S? | PTC? | E? | NA | NA | NA | NA | NA |
{6CZR - bacteria}
|
|
| 13 | puromycin | 439530 |
aminoacyl-nucleoside
|
472 | BAE | 60S | A site | E | D |
puromycin is a structural analog of aminoacyl-tRNA
|
NA | NA |
{1FFZ - archaea}, {1FG0 - archaea}, {1KQS - archaea}, {1NJM - bacteria},
{1NJO - bacteria}, {1NJP - bacteria}, {1Q7Y archaea}, {1Q81 - archaea}, {1Q82
- archaea}, {1VQL - archaea}, {1VQM - archaea}, {1VQN - archaea}, {1VQO -
archaea}, {1VQP - archaea}, {1VVJ - bacteria}, {1VY6 - bacteria}, {1VY7 -
bacteria}, 2DPT, {3CD6 - archaea}, 3Q3D, {4L47 - bacteria}, {4L71 - bacteria},
{4LEL - bacteria}, {4LFZ - bacteria}, {4LNT - bacteria}, {4LSK - bacteria},
{4LT8 - bacteria}, {4P70 - bacteria}, {4TUA - bacteria}, {4TUB - bacteria},
{4TUC - bacteria}, {4TUD - bacteria}, {4TUE - bacteria}, {4YZV - bacteria},
{4ZSN - bacteria}, {5LYB - yeasts}, {6N9E - bacteria}, {6NDK - bacteria},
{6OTR - bacteria}, {6OXA - bacteria}, {6OXI - bacteria}
|
||
| 12 | A201A | 137348262 |
aminoacyl-nucleoside
|
803 | BAE | 60S | A site | E | PTC inhibitor | NA | NA | 26028538 | NA | NA |
{4Z3S - bacteria}
|
| 15 | baciphelacin | 171612 | isocoumarin | 423 | BAE | NA | NA | I?, R? | NA |
it does not act at the stage of attachment of the substrate to the ribosome,
or during the formation of a peptide bond
|
DOI | NA | NA |
{4W2F - bacteria}, {5I4L - yeasts}
|
|
| 16 | actinobolin | 54688606 | isocoumarin | 300 | BAE | 60S | PTC | E | PTC inhibitor | NA | NA | 7196909 | NA | NA | NA |
| 14 | 25223631 | isocoumarin | 424 | BAE | 40S | E site | E | NA | NA | NA | NA |
{4W2F - bacteria}, {5I4L - yeasts}
|
|||
| 214 | oosponol | 5324556 | isocoumarin | 220 | BAE? | 40S? | NA | E? | NA | NA | NA | 9210464 | NA | NA | NA |
| 17 | bactobolin | 54676871 | isocoumarin | 383 | BAE? | 60S | PTC (P) | E | NA | NA | NA | NA |
{4WT8 - bacteria}
|
||
| 123 | AHR-1911 | 31429 |
thiopseudourea
|
356 | BAE | 60S? | PTC? | E | PTC inhibitor | NA | NA | 4822728 | NA | NA | NA |
| 2 | 54683011 | pyrroline | 197 | E | 60S? [50S] |
PTC (A, P) | NA | S | NA | NA | NA | ||||
| 186 | 3081434 |
cyclic peptide
|
823 | BAE? | 60S? [50S] |
PTC? [A site] |
E? | [not D] | NA | 6337880 | NA | NA | NA | ||
| 185 | 42640128 |
cyclic peptide
|
711 | BAE | 40S, 60S |
uS17, uL3, uL30, etc.
|
NA | NA | NA |
the San B derivatives bound proteins from the 40S (S11) and the 60S (L3, 7,
12, 18, 23) subunits, whereas 2-tag derivative appears to primarily interact
with 60S ribosomal subunits (L9, 10, 13, 17)
|
DOI | NA | NA | NA | |
| 56 | griseoviridin | 11225326 |
cyclodepsipeptide
|
477 | BAE | 60S | PTC | E | NA |
affinity to eukaryotic ribosomes is much lower than to bacterial ribosomes;
the spectrum of action is comparable to that of streptogramin A
|
1096949 DOI |
NA | NA | NA | |
| 204 | 54675761 |
ergoline alkaloid
|
336 | BAE | 60S? | NA | E | NA |
competition of the toxin with the eukaryotic elongation factor EF1 and
EF2,
only appears to be toxic in high concentrations |
DOI | NA | NA | NA | ||
| 225 | doxycycline | 54671203 |
aromatic polyketide, tetracycline group
|
444 | BAE | 40S, 60S | PET etc. | E? | NA | NA | NA | 30318461 | from 50$ | NA | |
| 224 | minocycline | 54675783 |
aromatic polyketide, tetracycline group
|
457 | BAE |
40S? 60S?
[30S] |
[16S] | E? | NA | NA |
it shows a wide range of activity, including anti-inflammatory,
neuroprotective and neuroprotective effects
|
from 30$ | NA | ||
| 222 | 129395 |
aromatic polyketide, tetracenomycin group
|
486 | BAE | 60S | PET | E? |
prevents the progress of the synthesized peptide in the ribosomal tunnel?
|
NA | NA | 32601485 | NA | NA |
{6Y69 - bacteria}, {6Y6X - human}
|
|
| 221 | NA |
aromatic polyketide, tetracycline group
|
NA | BAE | 40S, 60S | PET etc. | E? | NA | NA |
metalloproteins inhibitor, SMILES:
NC(C1=C(O)CC(C2)[C@@](C1=O)(O)C=C(C2C3)C(C4=C3C=CC=C4O)=O)=O
|
NA | NA | NA | ||
| 223 | tigecycline | 54686904 |
aromatic polyketide, tetracenomycin group
|
586 | BAE | 40S?, 60S? | NA | E | NA | NA | [11163189] | from 60$ |
{1HNW - bacteria}
|
||
| 226 | doxorubicin | 31703 |
aromatic polyketide,
anthracycline group |
544 | E? | NA | NA | T | NA | NA | 1277199 | NA | NA | ||
| 220 | actiphenol | 245940 | glutarimide | 275 | E | 60S? | E site? | E? | NA | low activity | NA | from 267$ | NA | ||
| 111 | 73396 | glutarimide | 339 | E | 60S | E site? | E | S | NA | 5220953 | NA | NA | NA | ||
| NA | NA | glutarimide | NA | NA | 60S? | E site? | E? | NA |
10 times more active than cycloheximide
|
30802354 | NA | ? | NA | ||
| 114 | 11669726 | glutarimide | 458 | E | 60S | E (C3993) | E | D | NA | NA | from 1140$ |
{4U4R - yeasts}
|
|||
| 110 | 91467 | glutarimide | 297 | E | 60S | E site? | E? | S | NA | NA |
{4U3U - yeasts}, {5GAK - yeasts}, {5LKS - human}, {6HD7 - yeasts}, {6TNU -
yeasts}, {6Y0G - human}, {6Y2L - human}
|
||||
| 107 | 145721258 | glutarimide | NA | BAE | 60S? | E site? | E? | NA | NA | 31584271 | NA | NA | NA | ||
| 117 | 125175 | glutarimide | 334 | NA | NA | E site? | E? | NA |
10 times more active than cycloheximide, binds irreversibly
|
30802354 | NA | from 38$ | NA | ||
| 109 | 6197 | glutarimide | 281 | E | 60S | E site | E | S | NA | NA | from 37$ | NA | |||
| 113 | 15940571 | glutarimide | 490 | E | 60S? | E site? | E? | NA | NA | 20118940 | NA | NA | NA | ||
| 108 | naramycin B | 120760 | glutarimide | 281 | E | 60S? | E site? | NA | NA |
stereoisomer of cycloheximid
|
DOI | NA | NA |
{5GAK - yeasts}, {6Y2L - humans}
|
|
| 112 | 5351572 | glutarimide | 293 | E | 60S | E site? | E | NA | NA | NA | from 321$ | NA | |||
| 115 | ECA-LTM | NA | glutarimide | NA | E | 60S? | E site? | E? | NA | 26577990 | NA | NA | NA | ||
| NA | NA |
labdane diterpenoid
|
400 | E | 60S? | E site? | E? | NA | NA | 29064494 | NA | ? | NA | ||
| 234 | 10549927 |
labdane diterpenoid
|
418 | E | 60S | E site | E | S? | NA | 16540697 | NA | NA |
{5TBW - yeasts}, {6HHQ - yeasts}
|
||
| 233 | NA |
labdane diterpenoid
|
NA | E | 60S |
E site (G2794)
|
E | S |
SMILES:
O=C(NC(C1)=O)[C@H]1[C@@H](C)C[C@H]([C@]2(C)[C@@](CC3[H])(C)C(C)(C)[C@@H](C)[C@@H](C)C2)C3=C
|
30759226 | NA | NA | NA | ||
| 235 | NA |
labdane diterpenoid
|
NA | E | NA | NA | E | S |
SMILES:
O=C(NC(C1)=O)[C@H]1[C@@H](O)C[C@H]([C@]2(C)[C@@](C[C@@H]3OC(C)=O)([H])C(C)(C)[C@@H](Cl)[C@@H](Cl)C2)C3=C
|
29064494 | NA | NA | NA | ||
| 236 | 21778723 |
labdane diterpenoid
|
426 | E | NA | NA | E | S | NA | 29064494 | NA | NA | NA | ||
| 238 | 21778724 |
labdane diterpenoid
|
350 | E | NA | E site? | E | S | NA | 29064494 | NA | NA |
{5TBW - yeasts}
|
||
| 237 | 127675 |
labdane diterpenoid
|
384 | E | 60S | E site | E | S? | NA | NA | NA |
{5TBW - yeasts}, {6HHQ - yeasts}
|
|||
| 48 | 6436218 | glycoside | 805 | E | 60S | E site | E | D |
another activity is a stop-codon-independent ribosome dissociation;
irreversible inhibitor (see covalent bond on 4U4Z structure)
|
NA | NA | 4U4Z | |||
| 49 | 5477653 | glycoside | 763 | E | 60S? | E site? | NA | NA | NA | 14970397 | NA | NA |
{4U4Z - yeasts}
|
||
| 45 | 10345974 | 504 | BAE | 60S | E (C3993) | E | NA | NA | NA | NA |
{3I55 - archaea}
|
||||
| 44 | 6711419 | 518 | BAE | 60S | E (C3993) | E | D | NA | NA | NA | NA | ||||
| 47 | onnamide A | 23426006 | 794 | A?E | 60S | E site | E | NA |
causes ribotoxic stress
|
15958059 | NA | NA | NA | ||
| 43 | pederine | 5381287 | 504 | E | 60 | E site | E | S/d |
causes ribotoxic stress
|
NA | NA |
{3I55 - archaea}
|
|||
| 230 | 11692946 | 610 | E | 60S | E site | E | NA | NA | 22827176 | NA | NA | NA | |||
| 46 | 101627278 | 544 | AE | 60S | E site | E | NA | NA | 15958059 | NA | NA | NA | |||
| 105 | 71306325 | 373 | AE | eEF2? | NA | E | NA | 23303710 | NA | NA | NA | ||||
| 106 | 100917959 | 373 | AE | eEF2? | NA | E | NA | 23303710 | NA | NA | NA | ||||
| 64 | 16040283 | 595 | AE | 60S | E site | E | NA | NA | NA |
{2OTJ - archaea}
|
|||||
| 63 | tedanolide | 5478005 | 611 | A?E | 60S | E site | E | NA | NA | NA | NA |
{2OTJ - archaea}
|
|||
| 183 | 21022 | 479 | E | 40S? | E site? | E? | (S) | NA | 560858 | NA | from 764$ | NA | |||
| 182 | cephaeline | 442195 | 467 | E | 40S? | E site? | E? | (S) | NA | NA | from 109$ |
{3J7A - plasmodium}, {6OKK - plasmodium}
|
|||
| 181 | emetine | 10219 | 481 | E | 40S | E site | E | S |
antiprotozoal and anthelmintic agent
|
NA | from 228$ |
{3J7A - plasmodium}, {6OKK - plasmodium}
|
|||
| 211 | 92765 | 377 | E | 40S, 60S? | E site | E | NA | NA | NA | from 353$ |
{4U55 - yeasts}
|
||||
| 208 | tylocrebrine | 246845 | 394 | B?E | 40S? | E site? | E | NA | NA | NA | NA |
{4U55 - yeasts}
|
|||
| 207 | 92114 | 394 | B?AE | 40S | E site? | E | S | NA | NA | NA |
{4U55 - yeasts}
|
||||
| 180 | tubulosine | 72341 | 476 | E | 40S, 60S? | E site? | E | NA | NA | NA | NA | NA | |||
| 206 | DCB-3503 | 402628 | 410 | E | 40S? | E site? | E | NA | NA | 23251437 | NA | NA | NA | ||
| 212 | 57397503 | 378 | E | 40S? | E site? | E | NA | NA | 23251437 | NA | NA | NA | |||
| 210 | YXM-109 | 60200110 | NA | E | 40S? | E site? | E | NA | NA | 23251437 | NA | NA | NA | ||
| 209 | YXM-110 | 60200111 | NA | E | 40S? | E site? | E | NA | NA | 23251437 | NA | NA | NA | ||
| 10 | 56652064 | NA | BAE | 40S? | E site? | E (I?) | NA | NA | [23702293] | NA | NA | NA | |||
| 11 | pactamycin | 5289124 | 559 | BAE | 40S | E site | E, (I?) | (D) | NA | NA |
{1HNX - bacteria}, {4KHP - bacteria}, {4U4Y - yeasts}, {4W2G - bacteria},
{4W2H - bacteria}
|
||||
| 65 | zaluzanin C | 72646 | 246 | E | NA | NA | E | NA | NA | 6383382 | NA | NA | NA | ||
| 28 | 123865 |
2-DOS aminoglycoside, 4,6-disubstituted
|
497 | BE | 40S, 60S | DC, PET | E, T | D | NA | NA | NA |
RNA{1MWL - bacteria}, RNA{4K32 - leishmanial}, 30S{4LF9 - archaea}, {4V55 -
bacteria}, 5CFT, 5IQC, 5IQG, {5NDG - yeasts}, 5OBM, 5U0T, 5U18, 5U19, 5U1I,
5XZ1, 5Z71, 5Z8A, 5ZEI, 6MN1, 6MN5, 6NP3, 6NTJ, 6O97
|
|||
| 27 | 86483 |
2-DOS aminoglycoside, 4,6-disubstituted
|
478 | BE | 60S | DC, PET | E, T | D | NA | NA |
{4V53 - bacteria}
|
||||
| 42 | netilmicin | 441306 |
2-DOS aminoglycoside, 4,6-disubstituted
|
476 | BAE? | 40S? | DC? | E? | D? | NA | DOI | EU 1 | NA |
4F8U, 4F8V, 5C4L, 5U08, 6BBZ, 6BC2, 6BC3, 6BC7, 6CAP, 6CAR, 6MB4, 6MN2, 6NP2
|
|
| 41 | tobramycin | 36294 | 468 | BE? | 40S, 60S? | DC | E, T | D? |
irreversible inhibitor
|
from 40$ |
1EI2, 1FJG, 1FYP, 1I9V, 1IBK, 1IBL, 1J7T, 1KNY, 1L8T, 1LC4, 1M4D, 1M4G,
1M4I, 1N32, 1N33, 1ND4, 1S3Z, 1V0C, 1VVJ, 1XMO, 1XMQ, 1XNQ, 1XNR, 2A04, 2B0Q,
2BUE, 2ESI, 2ESJ, 2ET4, 2ET5, 2ET8, 2F4S, 2FCX, 2FCY, 2FCZ, 2FD0, 2KXM, 2MXS,
2N0J, 2O3V, 2O3W, 2O3X, 2QIR, 2UU9, 2UUA, 2UUB, 2UUC, 2UXB, 2UXC, 2UXD, 2VQE,
2VQF, 2VQY, 3BNQ, 3BNR, 3C3Z, 3C44, 3C5D, 3C7R, 3DVV, 3KP5, 3Q5R, 3SG8, 3SG9,
3T1H, 3T1Y, 3U6T, 3VET, 4DFB, 4DFU, 4DR2, 4DR4, 4EBK, 4EM0, 4EVY, 4FEU, 4FEV,
4FEW, 4FEX, 4GKH, 4GKI, 4GKJ, 4GKK, 4JD6, 4JYA, 4KHP, 4L47, 4L71, 4LEL, 4LF6,
4LF7, 4LF8, 4LFB, 4LFC, 4LNT, 4LSK, 4LT8, 4OKN, 4P6F, 4P70, 4QB9, 4QC6, 4TUA,
4TUB, 4TUD, 4TUE, 4V51, 4V52, 4V57, 4V5C, 4V5D, 4V5G, 4V5L, 4V5Y, 4V8C, 4V8F,
4V8J, 4V97, 4V9C, 4W29, 4WOI, 4WQL, 4WRA, 4WSD, 4WT8, 4X62, 4X64, 4X65, 4X66,
4XJE, 4ZC7, 5A9Z, 5AA0, 5BR8, 5CFS, 5DV4, 5EL6, 5EL7, 5IB7, 5IQB, 5IQD, 5IQE,
5IQR, 5NDJ, 5NDK, 5NDV, 5NDW, 5TCU, 5U0N, 5U0T, 5U1E, 5U1I, 5WNT, 5WNU, 5WNV,
5Z8K, 5ZEJ, 6AZ1, 6AZ3, 6BFH, 6C5U, 6CAO, 6CAV, 6CEY, 6CTZ, 6DTI, 6E0D, 6FD2,
6JW7, 6JW8, 6MB5, 6MB7, 6MB9, 6MKN, 6MPF, 6MPI, 6NMK, 6NML, 6NMM, 6NMN, 6NP4,
6NP5, 6NTI, 6O5U, 6OF6, 6OJ2, 6OPE, 6ORD, 6P04, 6P06, 6P08, 6S0S, 6S0V, 6S0W,
6UN8, 7K00
|
||||
| 38 | lividomycin | 72394 | 762 | BAE? | 40S? | DC? | E | NA | NA | NA | NA | NA |
1EI2, 1FJG, 1FYP, 1I9V, 1IBK, 1IBL, 1J7T, 1KNY, 1L8T, 1LC4, 1M4D, 1M4G,
1M4I, 1N32, 1N33, 1ND4, 1S3Z, 1V0C, 1VVJ, 1XMO, 1XMQ, 1XNQ, 1XNR, 2A04, 2B0Q,
2BEE, 2BUE, 2ESI, 2ESJ, 2ET4, 2ET5, 2ET8, 2F4S, 2FCX, 2FCY, 2FCZ, 2FD0, 2KXM,
2MXS, 2N0J, 2O3V, 2O3W, 2O3X, 2QIR, 2UU9, 2UUA, 2UUB, 2UUC, 2UXB, 2UXC, 2UXD,
2VQE, 2VQF, 2VQY, 3BNQ, 3BNR, 3C3Z, 3C44, 3C5D, 3C7R, 3DVV, 3KP5, 3Q5R, 3SG8,
3SG9, 3T1H, 3T1Y, 3U6T, 3VET, 4DFB, 4DFU, 4DR2, 4DR4, 4EBK, 4EM0, 4EVY, 4FEU,
4FEV, 4FEW, 4FEX, 4GKH, 4GKI, 4GKJ, 4GKK, 4JD6, 4JYA, 4KHP, 4L47, 4L71, 4LEL,
4LF6, 4LF7, 4LF8, 4LFB, 4LFC, 4LNT, 4LSK, 4LT8, 4OKN, 4P6F, 4P70, 4QB9, 4QC6,
4TUA, 4TUB, 4TUD, 4TUE, 4V51, 4V52, 4V57, 4V5C, 4V5D, 4V5G, 4V5L, 4V5Y, 4V8C,
4V8F, 4V8J, 4V97, 4V9C, 4W29, 4WOI, 4WQL, 4WRA, 4WSD, 4WT8, 4X62, 4X64, 4X65,
4X66, 4XJE, 4ZC7, 5A9Z, 5AA0, 5BR8, 5CFS, 5DV4, 5EL6, 5EL7, 5IB7, 5IQB, 5IQD,
5IQE, 5IQR, 5NDJ, 5NDK, 5NDV, 5NDW, 5TCU, 5U0N, 5U1E, 5WNT, 5WNU, 5WNV, 5Z8K,
5ZEJ, 6AZ1, 6AZ3, 6BFH, 6C5U, 6CAO, 6CAV, 6CEY, 6CTZ, 6DTI, 6E0D, 6FD2, 6JW7,
6JW8, 6MB5, 6MB7, 6MB9, 6MKN, 6MPF, 6MPI, 6NMK, 6NML, 6NMM, 6NMN, 6NP4, 6NP5,
6NTI, 6O5U, 6O97, 6OF6, 6OJ2, 6OPE, 6ORD, 6P04, 6P06, 6P08, 6S0S, 6S0V, 6S0W,
6UN8, 7K00
|
||
| 36 | neomycin | 8378 | 615 | BAE? | 40S? | DC? | (R?) | NA | NA | NA |
1EI2, 1FJG, 1FYP, 1I9V, 1IBK, 1IBL, 1J7T, 1KNY, 1L8T, 1LC4, 1M4D, 1M4G,
1M4I, 1N32, 1N33, 1ND4, 1S3Z, 1V0C, 1VVJ, 1XMO, 1XMQ, 1XNQ, 1XNR, 2A04, 2B0Q,
2BEE, 2BUE, 2ESI, 2ESJ, 2ET4, 2ET5, 2ET8, 2F4S, 2FCX, 2FCY, 2FCZ, 2FD0, 2KXM,
2MXS, 2N0J, 2O3V, 2O3W, 2O3X, 2QIR, 2UU9, 2UUA, 2UUB, 2UUC, 2UXB, 2UXC, 2UXD,
2VQE, 2VQF, 2VQY, 3BNQ, 3BNR, 3C3Z, 3C44, 3C5D, 3C7R, 3DVV, 3KP5, 3Q5R, 3SG8,
3SG9, 3T1H, 3T1Y, 3U6T, 3VET, 4DFB, 4DFU, 4DR2, 4DR4, 4EBK, 4EM0, 4EVY, 4FEU,
4FEV, 4FEW, 4FEX, 4GKH, 4GKI, 4GKJ, 4GKK, 4JD6, 4JYA, 4KHP, 4L47, 4L71, 4LEL,
4LF6, 4LF7, 4LF8, 4LFB, 4LFC, 4LNT, 4LSK, 4LT8, 4OKN, 4P6F, 4P70, 4QB9, 4QC6,
4TUA, 4TUB, 4TUD, 4TUE, 4V51, 4V52, 4V57, 4V5C, 4V5D, 4V5G, 4V5L, 4V5Y, 4V8C,
4V8F, 4V8J, 4V97, 4V9C, 4W29, 4WOI, 4WQL, 4WRA, 4WSD, 4WT8, 4X62, 4X64, 4X65,
4X66, 4XJE, 4ZC7, 5A9Z, 5AA0, 5BR8, 5CFS, 5DV4, 5EL6, 5EL7, 5IB7, 5IQB, 5IQD,
5IQE, 5IQR, 5NDJ, 5NDK, 5NDV, 5NDW, 5TCU, 5U0N, 5U1E, 5WNT, 5WNU, 5WNV, 5Z8K,
5ZEJ, 6AZ1, 6AZ3, 6BFH, 6C5U, 6CAO, 6CAV, 6CEY, 6CTZ, 6DTI, 6E0D, 6FD2, 6JW7,
6JW8, 6MB5, 6MB7, 6MB9, 6MKN, 6MPF, 6MPI, 6NMK, 6NML, 6NMM, 6NMN, 6NP4, 6NP5,
6NTI, 6O5U, 6O97, 6OF6, 6OJ2, 6OPE, 6ORD, 6P04, 6P06, 6P08, 6S0S, 6S0V, 6S0W,
6UN8, 7K00
|
||||
| 37 |
paromomycin
|
165580 | 616 | BE | 40S, 60S | DC | (R?) | D | USA 9, EU 1 | from 213$ |
1EI2, 1FJG, 1FYP, 1I9V, 1IBK, 1IBL, 1J7T, 1KNY, 1L8T, 1LC4, 1M4D, 1M4G,
1M4I, 1N32, 1N33, 1ND4, 1S3Z, 1V0C, 1VVJ, 1XMO, 1XMQ, 1XNQ, 1XNR, 2A04, 2B0Q,
2BEE, 2BUE, 2ESI, 2ESJ, 2ET4, 2ET5, 2ET8, 2F4S, 2FCX, 2FCY, 2FCZ, 2FD0, 2KXM,
2MXS, 2N0J, 2O3V, 2O3W, 2O3X, 2QIR, 2UU9, 2UUA, 2UUB, 2UUC, 2UXB, 2UXC, 2UXD,
2VQE, 2VQF, 2VQY, 3BNQ, 3BNR, 3C3Z, 3C44, 3C5D, 3C7R, 3DVV, 3KP5, 3Q5R, 3SG8,
3SG9, 3T1H, 3T1Y, 3U6T, 3VET, 4DFB, 4DFU, 4DR2, 4DR4, 4EBK, 4EM0, 4EVY, 4FEU,
4FEV, 4FEW, 4FEX, 4GKH, 4GKI, 4GKJ, 4GKK, 4JD6, 4JYA, 4KHP, 4L47, 4L71, 4LEL,
4LF6, 4LF7, 4LF8, 4LFB, 4LFC, 4LNT, 4LSK, 4LT8, 4OKN, 4P6F, 4P70, 4QB9, 4QC6,
4TUA, 4TUB, 4TUD, 4TUE, 4V51, 4V52, 4V57, 4V5C, 4V5D, 4V5G, 4V5L, 4V5Y, 4V8C,
4V8F, 4V8J, 4V97, 4V9C, 4W29, 4WOI, 4WQL, 4WRA, 4WSD, 4WT8, 4X62, 4X64, 4X65,
4X66, 4XJE, 4ZC7, 5A9Z, 5AA0, 5BR8, 5CFS, 5DV4, 5EL6, 5EL7, 5IB7, 5IQB, 5IQD,
5IQE, 5IQR, 5NDJ, 5NDK, 5NDV, 5NDW, 5TCU, 5U0N, 5U1E, 5WNT, 5WNU, 5WNV, 5Z8K,
5ZEJ, 6AZ1, 6AZ3, 6BFH, 6C5U, 6CAO, 6CAV, 6CEY, 6CTZ, 6DTI, 6E0D, 6FD2, 6JW7,
6JW8, 6MB5, 6MB7, 6MB9, 6MKN, 6MPF, 6MPI, 6NMK, 6NML, 6NMM, 6NMN, 6NP4, 6NP5,
6NTI, 6O5U, 6O97, 6OF6, 6OJ2, 6OPE, 6ORD, 6P04, 6P06, 6P08, 6S0S, 6S0V, 6S0W,
6UN8, 7K00
|
||||
| 31 | NB124 | 71461381 | 581 | B?E | 40S | DC? | E, T | NA | NA | EU 1 | NA |
1EI2, 1FJG, 1FYP, 1I9V, 1IBK, 1IBL, 1J7T, 1LC4, 1M4D, 1M4G, 1N32, 1N33,
1S3Z, 1V0C, 1VVJ, 1XMO, 1XMQ, 1XNQ, 1XNR, 2A04, 2B0Q, 2BUE, 2ESJ, 2ET4, 2ET5,
2FCY, 2FCZ, 2FD0, 2KXM, 2MXS, 2N0J, 2O3W, 2O3X, 2QIR, 2UU9, 2UUA, 2UUB, 2UUC,
2UXB, 2UXC, 2UXD, 2VQE, 2VQF, 2VQY, 3BNQ, 3BNR, 3C3Z, 3C44, 3C5D, 3C7R, 3DVV,
3SG8, 3T1H, 3T1Y, 3VET, 4DR2, 4DR4, 4EBK, 4EVY, 4GKJ, 4GKK, 4JD6, 4JYA, 4KHP,
4L47, 4L71, 4LEL, 4LF6, 4LF7, 4LF8, 4LFB, 4LFC, 4LNT, 4LSK, 4LT8, 4P6F, 4P70,
4QB9, 4TUA, 4TUB, 4TUD, 4TUE, 4V51, 4V52, 4V57, 4V5C, 4V5D, 4V5G, 4V5L, 4V5Y,
4V8C, 4V8F, 4V8J, 4V97, 4V9C, 4W29, 4WOI, 4WRA, 4WSD, 4WT8, 4X62, 4X64, 4X65,
4X66, 4XJE, 4ZC7, 5A9Z, 5AA0, 5BR8, 5CFS, 5DV4, 5EL6, 5EL7, 5IB7, 5IQD, 5IQE,
5IQR, 5NDJ, 5NDK, 5NDV, 5NDW, 5TCU, 5U0N, 5U1E, 5WNT, 5WNU, 5WNV, 5ZEJ, 6AZ1,
6AZ3, 6C5U, 6CAO, 6CAV, 6CEY, 6DTI, 6MB5, 6MB7, 6MB9, 6MKN, 6MPF, 6MPI, 6NMK,
6NML, 6NMM, 6NMN, 6NP4, 6NP5, 6NTI, 6OF6, 6OJ2, 6OPE, 6ORD, 6P04, 6P06, 6P08,
6S0S, 6S0W, 6UN8, 7K00
|
|||
| 30 | NB74 | 71461382 | NA | B?E | 40S | DC | E, T | NA | NA | 23148581 | NA | NA | NA | ||
| 26 | TC007 | 11735014 | 485 | BE | 60S, 40S |
PET, DC | T |
induces decoding errors,
promotes readthrough of stop
codons (inhibits translocation);
disrupts intersubunit rotation |
NA | NA | 29208708 | NA | NA |
1EI2, 1FJG, 1FYP, 1I9V, 1IBK, 1IBL, 1J7T, 1KNY, 1L8T, 1LC4, 1M4D, 1M4G,
1M4I, 1N32, 1N33, 1ND4, 1S3Z, 1V0C, 1VVJ, 1XMO, 1XMQ, 1XNQ, 1XNR, 2A04, 2B0Q,
2BEE, 2BUE, 2ESI, 2ESJ, 2ET4, 2ET5, 2ET8, 2F4S, 2FCX, 2FCY, 2FCZ, 2FD0, 2KXM,
2MXS, 2N0J, 2O3V, 2O3W, 2O3X, 2QIR, 2UU9, 2UUA, 2UUB, 2UUC, 2UXB, 2UXC, 2UXD,
2VQE, 2VQF, 2VQY, 3BNQ, 3BNR, 3C3Z, 3C44, 3C5D, 3C7R, 3DVV, 3KP5, 3Q5R, 3SG8,
3SG9, 3T1H, 3T1Y, 3U6T, 3VET, 4DFB, 4DFU, 4DR2, 4DR4, 4EBK, 4EM0, 4EVY, 4FEU,
4FEV, 4FEW, 4FEX, 4GKH, 4GKI, 4GKJ, 4GKK, 4JD6, 4JYA, 4KHP, 4L47, 4L71, 4LEL,
4LF6, 4LF7, 4LF8, 4LFB, 4LFC, 4LNT, 4LSK, 4LT8, 4OKN, 4P6F, 4P70, 4QB9, 4QC6,
4TUA, 4TUB, 4TUD, 4TUE, 4V51, 4V52, 4V57, 4V5C, 4V5D, 4V5G, 4V5L, 4V5Y, 4V8C,
4V8F, 4V8J, 4V97, 4V9C, 4W29, 4WOI, 4WQL, 4WRA, 4WSD, 4WT8, 4X62, 4X64, 4X65,
4X66, 4XJE, 4ZC7, 5A9Z, 5AA0, 5BR8, 5CFS, 5DV4, 5EL6, 5EL7, 5IB7, 5IQB, 5IQD,
5IQE, 5IQR, 5NDJ, 5NDK, 5NDV, 5NDW, 5TCU, 5U0N, 5U1E, 5WNT, 5WNU, 5WNV, 5Z8K,
5ZEJ, 6AZ1, 6AZ3, 6BFH, 6C5U, 6CAO, 6CAV, 6CEY, 6CTZ, 6DTI, 6E0D, 6FD2, 6JW7,
6JW8, 6MB5, 6MB7, 6MB9, 6MKN, 6MPF, 6MPI, 6NMK, 6NML, 6NMM, 6NMN, 6NP4, 6NP5,
6NTI, 6O5U, 6O97, 6OF6, 6OJ2, 6OPE, 6ORD, 6P04, 6P06, 6P08, 6S0S, 6S0V, 6S0W,
6UN8, 7K00
|
|
| 32 | NB157 | 127044574 | NA | B?E | 40S | DC | E, T | NA | NA | 27096052 | NA | NA | NA | ||
| 33 | NB156 | 127044572 | NA | B?E | 40S | DC | E, T | NA | NA | 27096052 | NA | NA | NA | ||
| 35 | apramycin | 3081545 | 540 | BE | 40S, [30S] |
18S (DC (G1408, A1491))
[16S (A1408, G1491)] |
E | NA |
apramycin shows high activity for bacterial ribosomes and comparable
selectivity for eukaryotic cytosolic ribosomes
|
USA 1 | NA |
1YRJ, 2G5K, 2M4Q, 2OE5, 2OE8, 4AQY, 4K31, 6MN4, 7JM2
|
|||
| 25 | neamine | 72392 |
2-DOS aminoglycoside, 4-disubstituted
|
322 | BE | 60S? | DC | E, T | D? |
common core component of many aminoglycosides
|
NA | NA |
1EI2, 1FJG, 1FYP, 1GYM, 1I9V, 1IBK, 1IBL, 1J7T, 1LC4, 1M4D, 1M4G, 1N32,
1N33, 1S3Z, 1V0C, 1VVJ, 1XMO, 1XMQ, 1XNQ, 1XNR, 2A04, 2B0Q, 2BUE, 2ESJ, 2ET4,
2ET5, 2ET8, 2F4S, 2FCX, 2FCY, 2FCZ, 2FD0, 2KXM, 2MXS, 2N0J, 2O3V, 2O3W, 2O3X,
2QIR, 2UU9, 2UUA, 2UUB, 2UUC, 2UXB, 2UXC, 2UXD, 2VQE, 2VQF, 2VQY, 3BNQ, 3BNR,
3C3Z, 3C44, 3C5D, 3C7R, 3DVV, 3SG8, 3T1H, 3T1Y, 3VET, 4DR2, 4DR4, 4EBK, 4EVY,
4GKJ, 4GKK, 4JD6, 4JYA, 4KHP, 4L47, 4L71, 4LEL, 4LF6, 4LF7, 4LF8, 4LFB, 4LFC,
4LNT, 4LSK, 4LT8, 4P6F, 4P70, 4QB9, 4TUA, 4TUB, 4TUD, 4TUE, 4V51, 4V52, 4V57,
4V5C, 4V5D, 4V5G, 4V5L, 4V5Y, 4V8C, 4V8F, 4V8J, 4V97, 4V9C, 4W29, 4WOI, 4WRA,
4WSD, 4WT8, 4X62, 4X64, 4X65, 4X66, 4XJE, 4ZC7, 5A9Z, 5AA0, 5BR8, 5CFS, 5DV4,
5EL6, 5EL7, 5IB7, 5IQD, 5IQE, 5IQR, 5NDJ, 5NDK, 5NDV, 5NDW, 5TCU, 5U0N, 5U1E,
5WNT, 5WNU, 5WNV, 5Z8K, 5ZEJ, 6AZ1, 6AZ3, 6C5U, 6CAO, 6CAV, 6CEY, 6DTI, 6E0D,
6FD2, 6JW7, 6JW8, 6MB5, 6MB7, 6MB9, 6MKN, 6MPF, 6MPI, 6NMK, 6NML, 6NMM, 6NMN,
6NP4, 6NP5, 6NTI, 6OF6, 6OJ2, 6OPE, 6ORD, 6P04, 6P06, 6P08, 6S0S, 6S0V, 6S0W,
6UN8, 7K00
|
||
| 34 | 56928061 |
2-DOS aminoglycoside, noncanonical compound
|
528 | BAE | 40S? | DC | (R?) | S | NA | NA | from 60$ | NA | |||
| 203 | CDX5-1 | 29556880 |
phthalimide group
|
NA | NA | NA | NA | NA | NA | NA | 27407112 | NA | NA | NA | |
| 241 | negamycin | 11118411 |
negamycin group
|
248 | BAE | 40S | 18S | T | S | NA | 31620232 | NA | NA |
{2QEX - archaea}, {4W2I - archaea}, {4WF1 - bacteria}
|
|
| 122 | TCP-1109 | 117729068 |
negamycin group
|
402 | E | 40S | NA | T | NA | NA | 31620232 | NA | NA | NA | |
| 240 | 42831 |
negamycin group
|
232 | E | NA | NA | T | NA | NA | 25044534 | NA | NA | NA | ||
| 239 | 102439777 |
negamycin group
|
345 | E | NA | NA | T | NA | NA | 25044534 | NA | NA | NA | ||
| 190 | 11219835 | ohhdiazoles | 284 | E | 60S? | A site? | Т? | NA |
the termination inhibition may be an artifact due to using luciferase as a
reporter;
approved for the treatment of Duchenne myodystrophy |
from 40$ | NA | ||||
| 205 | amlexanox | 2161 |
benzopyrans
|
298 | E | NA | NA | T | NA | NA | 22938201 | USA 3 | from 38$ |
2KOT, 4WBO, 5W5V, 6BOD, 6CQ1
|
|
| 7 | RTC204 | 864615 | NA | NA | E | NA | NA | T | NA |
a nonsense-mediated decay inhibitor; stabilizes mRNA with a nonsense
mutation and promotes the synthesis of a complete copy of the protein with
such mRNA
|
23774824 | NA | from 66$ | NA | |
| 118 | RTC219 | 43812630 | NA | NA | E | NA | NA | T | NA | NA | 23774824 | NA | NA | NA | |
| 120 | GJ071 | 3192008 | NA | NA | E |
many binding sites
|
many binding sites
|
T | NA |
less toxic in comparison with related compounds
|
NA | NA | NA | ||
| 199 | GJ072 | 43813055 | NA | NA | E |
many binding sites
|
many binding sites
|
T | NA |
less toxic in comparison with related compounds
|
NA | NA | NA | ||
| 200 | GJ103 | 71748051 | NA | NA | E | NA | NA | T | NA |
less toxic in comparison with related compounds
|
23774824 | NA | from 92$ | NA | |
| 9 | BZ16 | NA |
thiazolidinone group
|
NA | E | NA | NA | Т | NA |
RTC13 derivative
SMILES: COC1=CC(=CC=C1)C2CCC(CC3SC(=S)NC3=O)O2 |
NA | NA | NA | ||
| 194 | BZ6 | 41673734 |
thiazolidinone group
|
330 | E | NA | NA | Т | NA | NA | 21873052 | NA | NA | 5OP9 | |
| 202 | RTC13 | 1227681 |
thiazolidinone group
|
315 | E | 40S? |
many binding sites?
[16S] |
Т | NA | NA | NA | from 30$ | NA | ||
| 201 | RTC14 | 794138 |
thiazolidinone group
|
298 | E |
many binding sites?
|
NA | Т | NA |
no in vivo activity
|
NA | NA | NA | ||
| 196 |
QL-XII-47 / QL47
|
71748056 | QL47 group | 448 | E | NA | NA |
E (early stages)?
|
NA | NA |
inhibits protein neosynthesis initiated by both canonical cap-driven and
noncanonical initiation strategies; broad-spectrum antiviral activity
|
31914414 | NA | from 197$ | NA |
| 197 | YKL-04-085 | 137637635 | QL47 group | 492 | E | NA | NA | E? | NA | NA | 31914414 | NA | NA | NA | |
| 179 | 512882 | macrolide | 1562 | BE | 60S | NA | E | NA | NA | 24189724 | NA | NA | NA | ||
| 126 | 175985 | macrolide | 613 | E | NA | NA | NA | NA | NA | NA | NA | NA | NA | ||
| 213 | mefloquine | 4046 | quinoline | 378 | E* | 60S | GAC | E | NA |
antimalarial drug; unique mechanism fof action similar to thiostrepton and
other peptide antibiotics; binds at the landing site of translational factors
|
28288098 | NA | 5UMD, 5ZNI | ||
| 184 | daptomycin | 16134395 |
cyclic lipopeptide
|
1621 | BA?E | 40S | eS19 | NA | NA | NA | NA | 28680364 | NA | NA | |
| 216 | 161484 | NA | 282 | E | 40S? 60S? | NA | I |
blocks translation initiation by preventing the binding of the 60S ribosomal
subunit to the 48S pre-initiation complex
|
D |
resistanse is associated with changes in ribosome components
|
NA | NA | NA | ||
| 1 | 131917 | NA | 264 | AE | 60S | E site | T |
inhibits the release of the nancent peptide from the polisome
|
NA | NA | NA | NA | 2OTL | ||
| NA | edeine A | NA | NA | 739 | BAE | 40S, [30S] | E site | I |
disrupts binding or accomodation of Met-tRNA(i) in a P-site
|
NA |
poorly penetrates into mammalian cells, there is a structure data of it's
interaction with a yeast ribosome
|
25209664 | NA | ? | NA |
| NA | edeine B | NA | NA | 781 | BAE? | 40S? | E site? | I? |
disrupts binding or accomodation of Met-tRNA(i) in a P-site?
|
NA | NA | 1148278 | NA | ? | NA |
| 198 | 2794 | NA | 473 | BE | 60S | NA | I |
disrupts binding of elF6 with 60S subunit
|
NA | NA | 31936702 | from 16$ | NA | ||
| 195 | eIFsixty-4 | 4531207 | NA | 415 | E | 60S | NA | I |
disrupts binding of elF6 with 60S subunit
|
D |
disrupts the maturation of rRNA; eIFsixty-4 analogs
(eIFsixty-1 (clofazimine) and eIFsixty-6) also disrupt
the binding of eIF6 to the 60S subunit, but exhibit different cytotoxicity
depending on the dose and cell type
|
31936702 | NA | NA | NA |
| 116 | eIFsixty-6 | 73253915 | NA | 385 | NA | 60S | NA | I |
disrupts binding of elF6 with 60S subunit
|
NA | NA | 31936702 | NA | from 34$ | NA |
| 215 | NSC111041 | 269624 | NA | 189 | E | NA | NA | NA |
inhibits TDP2's binding to DNA without getting intercalated into DNA
|
NA | NA | NA | NA | NA | |
| 193 | NSC115183 | 411623 | NA | NA | E | NA | NA | NA | NA | NA |
did not signifcantly affect translation, the structure is currently not
available
|
14769948 | NA | NA | NA |
| 192 |
PF-06378503 (PF8503)
|
138544609 | NA | 449 | E | 60S? | PET? | E |
prevents the progress of the peptide in the ribosomal tunnel?
|
NA |
it is highly specific to the amino acid sequence and is active against a
small number of peptides
|
30875366 | NA | NA | NA |
| 191 |
PF-06446846 (PF846)
|
86271238 | NA | 434 | BAE | 60S | PET | E |
it prevents the progress of the peptide in the ribosomal tunnel, which leads
to changes in the conformation of PTC and inhibition of translocation, since
the 3`-CAA end of the peptidyl-tRNA is incorrectly oriented
|
NA |
it is highly specific to the amino acid sequence and is active against a
small number of peptides
|
NA | from 149$ | NA | |
| NA | oxo-aglaiastatin | NA | rocaglate, a synthetic derivative of aglaiastatin | NA | E | 60S | NA | NA | NA |
it is highly specific to the amino acid sequence and is active against a
small number of peptides
|
32101697 |
NA | ? | NA | |
| 8 | raphin1 | 9560222 | NA | 231 | BAE | 60S | NA | NA | NA | NA | 121341 |
NA | ? | NA |
| SC | Name | Pubchem CIDs | Class, group of chemical compounds | MW | Domain specifi- city (BAE) |
Target | Stage affected (IETR) |
Mechanism of action | Comments | References | Clinical trials | Cost and Vendors | PDB structures |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 131 | 2259 |
triphenylmethane
|
422 | BAE |
40S? tRNA? mRNA? eIF2-GTP-Met-tRNA(i)?
|
I, (E) |
inhibitor of eIF2-GTP-Met-tRNA(i) complex formation, affects binding of
mRNA, tRNA to ribosome, causes dissociation of ribosomes into separate
subparticles, inhibits elongation factors
|
nonspecific inhibitor of protein-nucleic acid interactions; does not
penetrate the cell membrane
|
NA | from 60$ | NA | ||
| 128 | gallin | 191336 |
xanthenelike,
gallin/fluorescein analog |
366 | B?A?E |
40S? tRNA? mRNA?
|
I, (E) |
inhibitor of eIF2-GTP-Met-tRNA(i) complex formation, affects binding of
mRNA, tRNA to ribosome
|
nonspecific inhibitor of protein-nucleic acid interactions; does not
penetrate the cell membrane
|
627208 | NA | NA | NA |
| 129 | 66993 | triphenyl | 386 | B?A?E |
40S? tRNA? mRNA? 60S? eIF2-GTP-Met-tRNA(i)?
|
I, (E) |
inhibitor of eIF2-GTP-Met-tRNA(i) complex formation, affects binding of
mRNA, tRNA to ribosome
|
nonspecific inhibitor of protein-nucleic acid interactions; does not
penetrate the cell membrane
|
NA | NA | NA | ||
| 132 | NSC119889 | 274104 |
gallin/fluorescein analog
|
650 | E? |
eIF2-GTP-Met-tRNA(i)?
|
I |
inhibitor of eIF2-GTP-Met-tRNA(i) complex formation, affects binding of
mRNA, tRNA to ribosome (affects binding of Aa-tRNA?)
|
inhibits translation in vivo and in vitro
|
16928960 | NA | NA | NA |
| 126 | NSC119893 | 274108 |
gallin/fluorescein analog
|
414 | E? |
eIF2-GTP-Met-tRNA(i)?
|
I |
inhibitor of eIF2-GTP-Met-tRNA(i) complex formation
|
reversible inhibitor;
inhibits in vivo translation; inhibits translation in vitro less effective; |
NA | NA | NA | |
| 20 | 28032 |
uridine analog
|
229 | BAE |
eIF2, eEF2?, eIF2-GTP-Met-tRNA(i)?
|
I, E |
inhibitor of eIF2-GTP-Met-tRNA(i) complex formation, elongation inhibitor
(inhibits eEF2 activity on the ribosome)?
|
nonspecific inhibitor of protein-nucleic acid interactions
|
976261 | NA | NA | NA | |
| 4 | histidinol | 776 | His analog | 141 | BAE |
His-tRNA synthetase
|
E |
inhibitor of His-tRNA synthetase and His biosynthesis
|
reversible inhibitor
|
4338230 | NA | NA |
1H3J, 1KAE, 1KMN, 2BKD, 2FPU, 4GYF, 4V8Y, 4V8Z, 5EQ8, 5VLC, 5YHT
|
| 17 | furanomycin | 73423 | lle analog | 157 | B?A?E |
Ile-tRNA synthetase
|
E |
Ile analog, inhibitor of Ile-tRNA synthetase
|
NA | 4861779 | NA | NA | NA |
| 19 | ribavirin | 37542 | m⁷G analog | 244 | E | eIF4E? | I |
perhaps, in some circumstances, it can compete with the m7G-cap for binding
to eIF4E?
|
NA | NA | from 25$ | NA | |
| 22 | 447830 | Met analog | 464 | BAE |
Met-tRNA synthetase
|
E |
inhibitor of Met-tRNA synthetase
|
NA | NA | NA |
12AS, 1AER, 1AM0, 1AMU, 1ANK, 1AW4, 1BKX, 1C0A, 1C0A, 1CGP, 1CJA, 1CT9,
1CVJ, 1CX4, 1D4R, 1DEL, 1DGS, 1DMA, 1DS5, 1E1T, 1ECJ, 1EFP, 1EFV, 1EXD, 1EYJ,
1EYK, 1FA9, 1FBP, 1FJ9, 1FNC, 1FND, 1FPD, 1FPE, 1FPF, 1FPG, 1FPI, 1FPJ, 1FPL,
1FRP, 1FSA, 1FTA, 1FVI, 1FYD, 1G51, 1G51, 1G6N, 1GGM, 1GPH, 1GPM, 1GTS, 1H1H,
1H3D, 1HDI, 1HI3, 1HTO, 1HTQ, 1HTT, 1HW5, 1I5Z, 1I6X, 1IL2, 1J20, 1J59, 1JBR,
1JID, 1JP4, 1JWB, 1K9Y, 1KA0, 1KHT, 1KPF, 1KTG, 1KZ8, 1LB2, 1LGR, 1LPC, 1LTK,
1M5V, 1MB9, 1MC1, 1MD9, 1MDB, 1MF0, 1MF1, 1MZV, 1N78, 1NH8, 1NHK, 1NKS, 1NSY,
1NV7, 1O0B, 1O0C, 1O0O, 1O3Q, 1O3R, 1O3S, 1O3T, 1O94, 1O95, 1O96, 1O97, 1OBD,
1OBG, 1OBT, 1ORE, 1P8L, 1PG3, 1PG4, 1PGQ, 1PTW, 1PYG, 1Q43, 1Q5O, 1QB8, 1QF6,
1QGX, 1RAO, 1RAW, 1RDY, 1RDZ, 1RGK, 1RGS, 1ROR, 1RUN, 1RUO, 1RY2, 1S68, 1SES,
1SK6, 1SON, 1T6Y, 1T9G, 1TB5, 1TB7, 1TBW, 1TUU, 1U6B, 1U6P, 1U9Z, 1UA4, 1UKZ,
1UUY, 1UXN, 1UXP, 1UXU, 1UXV, 1V26, 1V8S, 1V9P, 1VD1, 1VP6, 1W0H, 1WDY, 1WLE,
1WXE, 1WXI, 1X9N, 1XFW, 1XQS, 1XV6, 1Y1P, 1YKD, 1YXU, 1YYZ, 1YZ0, 1Z5U, 1Z6S,
1Z84, 1Z8D, 1ZAU, 1ZBH, 1ZBU, 1ZJW, 1ZN8, 1ZN9, 1ZRC, 1ZRD, 1ZRE, 1ZRF, 1ZZN,
2A1T, 2A1U, 2A7X, 2A86, 2AK3, 2ART, 2BWJ, 2C38, 2C5S, 2CFM, 2CGP, 2CNQ, 2D1Q,
2D1R, 2DCL, 2DEU, 2DSD, 2ECK, 2EQA, 2F17, 2F3D, 2FJB, 2G1U, 2GCS, 2GCV, 2GJW,
2GM3, 2GMK, 2GSU, 2GXQ, 2GXS, 2GZ2, 2GZW, 2H0S, 2H0W, 2H0X, 2HBL, 2HCR, 2HO6,
2HO7, 2HOJ, 2HVS, 2I4I, 2IVS, 2IVT, 2IYP, 2J91, 2J9D, 2JB7, 2JGD, 2K0G, 2KP3,
2LSC, 2N4J, 2NSY, 2OK7, 2OOX, 2OUN, 2OUR, 2OUY, 2OWO, 2OZ6, 2P20, 2P2B, 2P2F,
2P2J, 2P2M, 2P2Q, 2PTM, 2PTQ, 2PW3, 2PZA, 2Q2T, 2Q4H, 2Q8M, 2QGA, 2QJT, 2QRC,
2QRK, 2R7M, 2R84, 2R85, 2RH6, 2RIF, 2RRC, 2UV4, 2UV6, 2UV7, 2V8Q, 2V92, 2V9J,
2VAR, 2VD6, 2VFK, 2VII, 2VNI, 2VSO, 2VSX, 2VZE, 2W4Y, 2W4Z, 2WEF, 2X3K, 2X75,
2XD0, 2XDB, 2XDD, 2XOY, 2XOZ, 2XXB, 2Y8L, 2Y8Q, 2YA3, 2YAB, 2YB1, 2YDD, 2YJ4,
2YPE, 2YQ9, 2YRX, 2YS6, 2YVO, 2ZE5, 2ZE6, 2ZE7, 2ZMF, 2ZR2, 3A7A, 3A9V, 3AHW,
3AW8, 3B1R, 3B4A, 3B6J, 3BER, 3BLW, 3BO2, 3BO3, 3BO4, 3BPZ, 3C0H, 3C1Y, 3C21,
3C85, 3CJ7, 3CJ9, 3CLP, 3CLR, 3CLS, 3CLT, 3CLU, 3CW9, 3DAH, 3DDJ, 3DHV, 3DLZ,
3DQX, 3DRW, 3E3N, 3E7W, 3E7X, 3EPS, 3EQ6, 3ERR, 3ETQ, 3FEG, 3FHJ, 3FHM, 3FI0,
3FIT, 3FIU, 3FNA, 3FWZ, 3G1Z, 3G89, 3GC0, 3GLV, 3GRU, 3GYD, 3H3U, 3HF7, 3HHN,
3HW5, 3HXY, 3I0Q, 3I54, 3IB8, 3IFA, 3IFC, 3IIN, 3IUY, 3IYD, 3J7Y, 3JQP, 3JQQ,
3JTF, 3JWP, 3KCC, 3KD6, 3KFL, 3KGD, 3KH5, 3L2P, 3L31, 3L4B, 3L9W, 3LC6, 3LCB,
3LFR, 3LFZ, 3LHH, 3LKM, 3LOQ, 3LQ3, 3LUD, 3LW7, 3M84, 3MF2, 3MUV, 3MZH, 3N10,
3N4M, 3N8H, 3NEM, 3NGN, 3NGT, 3NKV, 3NQR, 3NRN, 3NUA, 3NYO, 3NYQ, 3NYR, 3NZT,
3O0F, 3O0M, 3OCP, 3OCV, 3OCX, 3OF1, 3OGJ, 3OMF, 3OTF, 3P4E, 3PCO, 3PNA, 3PWK,
3PWS, 3PY5, 3PZC, 3Q10, 3QFO, 3QH8, 3QOP, 3R1H, 3R1L, 3R6S, 3R96, 3RA8, 3RAA,
3RDI, 3REX, 3RK0, 3RL6, 3ROJ, 3ROU, 3RPH, 3RPL, 3RPQ, 3RPZ, 3RQ2, 3RRB, 3RYP,
3RYR, 3SBX, 3SF0, 3SGI, 3SHR, 3SP1, 3SPL, 3SR0, 3SYT, 3SZG, 3SZQ, 3T4B, 3T5M,
3TDH, 3TJ7, 3TLX, 3TLZ, 3TNJ, 3TSQ, 3TTF, 3TV1, 3TW2, 3TY9, 3TYX, 3U0Z, 3U10,
3U11, 3U1B, 3UK2, 3UQ6, 3UQ8, 3UY4, 3VBF, 3VER, 3VEX, 3VGJ, 3VNR, 3VNS, 3VQX,
3W1B, 3WJR, 3WUH, 3WVR, 3X01, 3X05, 3X07, 3X09, 3X0B, 3ZET, 4A2U, 4A59, 4AJC,
4AJS, 4ATO, 4AVB, 4AVC, 4AZS, 4B8S, 4BLW, 4BRF, 4BRN, 4BRQ, 4CF7, 4CFE, 4CFF,
4CFH, 4CLP, 4CLT, 4CO4, 4CS3, 4CS9, 4CT9, 4CYD, 4D05, 4D3H, 4D56, 4D57, 4D7A,
4D7T, 4DG8, 4E6N, 4EAI, 4EAJ, 4EAL, 4EBU, 4EEI, 4EFC, 4EG3, 4EPM, 4EQ4, 4EQ5,
4EQL, 4EUM, 4EV0, 4EYS, 4FBC, 4FBH, 4FBP, 4FF4, 4FRY, 4FT8, 4FWK, 4G0Y, 4G8L,
4GA6, 4GBV, 4GBW, 4GQY, 4GTW, 4GVL, 4GWS, 4GWY, 4GWZ, 4GX4, 4GX6, 4H2S, 4H2V,
4H2W, 4H46, 4HBN, 4HE2, 4HG0, 4HV4, 4HVJ, 4HXV, 4HZF, 4I01, 4I02, 4I09, 4I0A,
4I0B, 4I5W, 4IFZ, 4IG1, 4IJN, 4IKE, 4IMY, 4INI, 4ITR, 4JZK, 4K46, 4K9A, 4K9B,
4KBF, 4KFS, 4KKE, 4KR2, 4KXP, 4LFZ, 4LI4, 4LQY, 4M0K, 4M30, 4M9D, 4MA0, 4MGI,
4MGK, 4MPO, 4MX2, 4MX3, 4NDF, 4NDH, 4NDI, 4NNJ, 4NYB, 4NYC, 4NYD, 4NYG, 4O6R,
4O81, 4O82, 4O83, 4OKE, 4OXI, 4OZL, 4P1G, 4P5J, 4P69, 4PEH, 4PLX, 4Q86, 4QAK,
4QEI, 4QFG, 4QFR, 4QFS, 4QK8, 4QK9, 4QKA, 4QLM, 4QLN, 4QSH, 4QSK, 4QX5, 4R1L,
4R1M, 4R3W, 4R78, 4R8I, 4RDH, 4RDX, 4RER, 4REW, 4RLE, 4RMO, 4RVN, 4RWW, 4S1B,
4TS5, 4TWB, 4U3N, 4UP7, 4UUW, 4V1U, 4W90, 4W92, 4WB2, 4WB3, 4WCC, 4WDA, 4WDB,
4WDF, 4WDG, 4WER, 4WFR, 4WK1, 4WW7, 4WYP, 4X44, 4X45, 4XJE, 4XTT, 4Y5Q, 4YAF,
4YAL, 4YAO, 4YAU, 4YAW, 4YB6, 4YE2, 4YED, 4YP1, 4YS2, 4YXM, 4ZCF, 4ZGL, 4ZHX,
4ZKL, 4ZMF, 4ZXI, 5AHW, 5B6H, 5B8H, 5BPH, 5BSR, 5BTX, 5BU2, 5BUS, 5BYF, 5C6C,
5CFN, 5CIZ, 5CK7, 5COT, 5D0N, 5D1F, 5D4D, 5D4N, 5D4O, 5DJH, 5DJI, 5DRK, 5DS7,
5DW8, 5DY9, 5DYJ, 5DZT, 5E6M, 5E7J, 5ED3, 5ED6, 5ERS, 5ET6, 5EY8, 5EY9, 5EYT,
5F1F, 5F1G, 5F29, 5F5X, 5F74, 5F9Y, 5FBB, 5FCB, 5FDU, 5FDV, 5G40, 5G5X, 5GJU,
5GMD, 5GME, 5GTD, 5GXD, 5GYZ, 5GZ5, 5GZW, 5IE3, 5IFI, 5IKP, 5IPP, 5ISO, 5J3U,
5JDA, 5JH2, 5JJU, 5JMV, 5JRH, 5K27, 5K85, 5K8F, 5K8S, 5K99, 5KBF, 5KJX, 5KJY,
5KKG, 5KLZ, 5KOD, 5KQ5, 5KS7, 5L3Q, 5L6V, 5L95, 5LCD, 5LDM, 5LMO, 5LWJ, 5M45,
5MKO, 5MSC, 5MSD, 5MSQ, 5MSS, 5MST, 5MSW, 5N5U, 5N9X, 5NC8, 5NRH, 5NRI, 5NX9,
5O1U, 5O3Q, 5O3R, 5O4P, 5O4Z, 5O70, 5OFU, 5OW0, 5SVB, 5SXS, 5T5T, 5T8S, 5T8T,
5TVA, 5U6P, 5U7V, 5UDT, 5UFU, 5URI, 5UXF, 5V0I, 5VEO, 5VYZ, 5VZ0, 5W10, 5WM2,
5WM7, 5WS9, 5WSB, 5WSC, 5X0B, 5X0E, 5X0F, 5X0G, 5X0J, 5X0K, 5X8F, 5XET, 5XSN,
5XSP, 5YFU, 5YFV, 5YFW, 5YFX, 5YG8, 5YG9, 5YGA, 5YZ2, 5ZBK, 5ZBL, 5ZQ4, 5ZQ7,
5ZSN, 5ZU7, 5ZWK, 6A03, 6AEK, 6AIC, 6ANG, 6AVH, 6AWA, 6AX8, 6B1U, 6B2E, 6B6H,
6BKF, 6BKG, 6BLJ, 6C9F, 6C9G, 6C9H, 6C9J, 6CFF, 6CJU, 6CVO, 6CVP, 6CVQ, 6CVR,
6CVS, 6CVT, 6CY7, 6CZM, 6D31, 6DFE, 6DT1, 6DT4, 6DZG, 6E4T, 6E4U, 6E4W, 6E5Y,
6E8O, 6EA3, 6EH2, 6EOF, 6EP0, 6ESA, 6ETD, 6ETF, 6ETH, 6EZU, 6EZU, 6F2V, 6FCL,
6FD5, 6FD6, 6FD9, 6GAX, 6GB0, 6GB4, 6GB9, 6GBC, 6GBF, 6GDR, 6GPB, 6GPO, 6GPR,
6GQU, 6GYO, 6H1B, 6H4G, 6H7E, 6HE0, 6HE2, 6HQ3, 6HQ4, 6HQ5, 6HVL, 6HVL, 6III,
6IJB, 6ITO, 6IYF, 6J53, 6J58, 6JWQ, 6JWR, 6JWT, 6JWU, 6JWW, 6JWX, 6JWZ, 6K4R,
6K5L, 6K8K, 6KBY, 6KDU, 6KJM, 6KRH, 6KSC, 6L5M, 6LN3, 6LS5, 6M11, 6MMO, 6MMQ,
6MN8, 6MV7, 6N5K, 6N5L, 6N5N, 6N5O, 6N5P, 6N5Q, 6N5R, 6N5S, 6N5T, 6NAB, 6NE7,
6NFE, 6NMM, 6NMN, 6O0W, 6O3P, 6O6Q, 6O6Y, 6O6Y, 6O6Z, 6O70, 6O70, 6OF6, 6OFB,
6OMS, 6OQQ, 6OV0, 6OZ1, 6OZV, 6P08, 6P09, 6P0A, 6P0B, 6P0C, 6P0D, 6P0E, 6P4U,
6P63, 6P6U, 6P8Q, 6PB4, 6PB5, 6PB6, 6PJW, 6PLM, 6PMH, 6PMT, 6Q1V, 6QJZ, 6QL9,
6QUL, 6R8U, 6RAR, 6RAS, 6RAU, 6RCE, 6RMS, 6RNT, 6S2U, 6SHQ, 6SI8, 6SIW, 6SIY,
6SLT, 6SQ8, 6SVS, 6SY7, 6TM4, 6U7B, 6UFH, 6UQF, 6UQG, 6VPM, 6VT1, 6VT8, 6VTE,
6W6Y, 6WFJ, 6X7U, 6XNV, 6YMI, 6YML, 7BUM, 7CBB, 7GPB, 7JME, 7RNT, 8GPB
|
||
| 1 | 129856568 | Met analog | 228 | BAE |
Met-tRNA synthetase
|
E |
inhibitor of Met-tRNA synthetase
|
NA | 9934462 | NA | NA | NA | |
| 3 | ethionine | 25674 | Met analog | 163 | BAE |
Met-tRNA synthetase
|
I, E |
inhibitor of Met-tRNA synthetase, disrupts ATP metabolism in the cell
|
NA | 6752686 | NA | from 59$ |
1ABW, 1C21, 1D6S, 1F4L, 1G8S, 1INN, 1J6W, 1J6X, 1KBG, 1KQ0, 1KQ9, 1KSF,
1O9T, 1P1M, 1P7L, 1P99, 1PG2, 1Q7E, 1QQ9, 1RQR, 1TKJ, 1U1H, 1U1J, 1WKM, 1XS5,
1Y9Q, 1YJ3, 1ZUE, 2AJH, 2C5B, 2C5H, 2CIJ, 2FB3, 2GGC, 2P6S, 2Q33, 2Q6I, 2Q6L,
2QS8, 2V7X, 2VC1, 2WZ5, 2X1L, 2X1M, 3AEJ, 3AEM, 3AEN, 3AYL, 3C8F, 3F3D, 3GP4,
3GXA, 3H99, 3IIX, 3IR1, 3J81, 3JAP, 3JAQ, 3K2D, 3MX6, 3QSY, 3R8X, 3TJW, 3TQW,
3TRV, 3TRY, 3V11, 3VK3, 4EG1, 4EG4, 4EG5, 4EG6, 4EG7, 4EG8, 4EGA, 4FO8, 4GLS,
4GLU, 4IB2, 4IO6, 4JBL, 4L61, 4L65, 4MVW, 4MVX, 4MVY, 4MW0, 4MW1, 4MW2, 4MW4,
4MW5, 4MW6, 4MW7, 4MW9, 4MWB, 4MWC, 4MWD, 4MWE, 4OIJ, 4OIK, 4QFO, 4QHQ, 4QYM,
4R34, 4S27, 4U6J, 4U75, 4WCX, 4XN4, 4XO4, 4YAH, 4YTG, 4ZT2, 4ZT3, 4ZT4, 4ZT5,
4ZT6, 4ZT7, 5A1I, 5AGR, 5AGS, 5AGT, 5B6I, 5CGN, 5CGO, 5CPD, 5E68, 5ECP, 5EXK,
5FEW, 5FEX, 5FEZ, 5FF0, 5GOY, 5HHD, 5HR6, 5HR7, 5I1N, 5I1O, 5I1P, 5I1S, 5I5A,
5I5B, 5INX, 5IQR, 5J58, 5J59, 5J5A, 5JB3, 5JBH, 5LTX, 5NFH, 5TGS, 5TH5, 5TQU,
5TSU, 5TU6, 5URB, 5V1T, 5V49, 5VSM, 5XPK, 5YOH, 5YOI, 5YPD, 5YR7, 5YXF, 6AHI,
6BV4, 6CML, 6CNU, 6DZX, 6FD2, 6FYX, 6FYY, 6GSM, 6GSN, 6GYP, 6HTK, 6HTM, 6HTO,
6I8C, 6JF1, 6JV7, 6KP1, 6MES, 6OJA, 6PHM, 6PHN, 6PHQ, 6R8A, 6SPO, 6SPQ, 6SW9,
6SWC, 6SWX, 6TDO, 6TDQ, 6VD0, 6VE8, 6WDE, 6WOO, 6XI9, 7CCG
|
| 2 | 352864 | Met analog | 164 | BE |
Met-tRNA synthetase
|
E |
inhibitor of Met-tRNA synthetase
|
NA | 9934462 | NA | NA | NA | |
| 127 | gallein | 73685 |
fluorescein/gallin analogs
|
648 | E? | I? |
inhibitor of
eIF2-GTP-Met-tRNA(i) complex formation, affects binding of mRNA, tRNA
to ribosome
|
NA | 14769948 | NA | from 45$ | NA | |
| 135 | NSC119910 | 274122 |
fluorescein/gallin analogs
|
370 | E? |
40S? tRNA? mRNA?
|
I, E? | NA | 14769948 | NA | NA | NA | |
| 133 | NSC119911 | 274123 |
fluorescein/gallin analogs
|
314 | E? |
40S? tRNA? mRNA?
|
I, E? | NA | 14769948 | NA | NA | NA | |
| 134 | NSC119913 | 274125 |
fluorescein/gallin analogs
|
394 | E? |
40S? tRNA? mRNA?
|
I, E? | NA | 14769948 | NA | NA | NA | |
| 136 | NSC119915 | 274127 |
fluorescein/gallin analogs
|
316 | E? |
40S? tRNA? mRNA?
|
I, E? | NA | 14769948 | NA | NA | NA | |
| 130 | NSC378139 | 16212338 |
fluorescein/gallin analogs
|
532 | E? |
40S? tRNA? mRNA?
|
I, E? |
inhibitor of eIF2-GTP-Met-tRNA(i) complex formation and/or inhibit 43S
preinitiation complex formation
|
NA | 14769948 | NA | NA | NA |
| 97 | CM16 | 910172 |
beta-carboline
|
252 | E | eIF1AX, eIF3 | I |
inhibits the activity of initiator factors eIF1AX and eIF3?
|
NA | 28322844 | NA | from 20$ | NA |
| 111 | ternatin | 5459184 |
diterpene alkaloid
|
374 | E | eEF1A | E |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis
|
NA | 26651998 | NA | NA | NA |
| 110 | ochratoxin A | 442530 | isocoumarin | 404 | BAE |
Phe-tRNA synthetase
|
E |
inhibitor of Phe-tRNA synthetase
|
NA | 22069596 | NA | from 124$ | NA |
| 99 | pateamine A | 10053416 | macrodiolide | 556 | E | eIF4A | I |
inhibits the binding of eIF4A to eIF4G, promotes the formation of a stable
complex of eIF4A with eIF4B
|
suppresses cap-dependent and eIF4G-dependent IRES-directed translation
initiation and promotes the formation of stress granules
|
NA | NA | NA | |
| 21 | 456511 |
nucleoside amidophosphite
|
473 | E |
Pro-tRNA synthetase?
|
E |
inhibitor of Pro-tRNA synthetase
|
NA | 12678775 | NA | NA | 1H4S, 2I4M | |
| 15 | 11499245 | oxaboroles | 152 | E |
Leu-tRNA synthetase
|
E |
inhibitor of Leu-tRNA synthetase
|
NA | 21856301 | USA 6 | from 35$ | NA | |
| 35 | borrelidin | 6436801 | polyketide | 490 | BAE |
Thr-tRNA synthetase
|
E |
selective inhibitor of Thr-tRNA synthetase
|
NA | 25824639 | NA | from 203$ | NA |
| 18 | 52952025 | polyketide | 489 | E | (eIF2) | I |
presumably, it binds to the initiator factor eIF2 and affects its activity?
|
NA | 30063768 | NA | NA | NA | |
| 112 | 5377963 | polyketide | 538 | BAE | tRNA | E |
with high affinity binds almost all tRNAs, inhibiting their aminoacylation
|
NA | 9257649 | NA | NA | NA | |
| 9 | 9939559 | polyketide | 661 | E |
Ile-tRNA synthetase
|
E |
inhibitor of Ile-tRNA synthetase
|
effective against mature osteoblasts
|
NA | from 468$ | NA | ||
| 10 | 11848157 | polyketide | 503 | E |
Ile-tRNA synthetase
|
E |
inhibitor of Ile-tRNA synthetase
|
NA | 17929337 | NA | NA | NA | |
| 138 | arnamial | 44557095 |
polyketide-sesquiterpene
|
449 | E | eEF2 | NA | fungicide | 31042251 | NA | NA | NA | |
| 114 | DDD107498 | 71748268 |
quinoline derivative
|
581 | NA | eEF2 | E |
antimalarial drug
|
26085270 | USA 2 | from 85$ | NA | |
| 24 | sordarin | 485851 | sordarin | 493 | E* | eEF2 | E | NA | NA | NA | |||
| 30 | GW 471552 | 216471 |
sordarin derivatives
|
472 | E* | eEF2 | E | fungicide | 11600368 | NA | NA | NA | |
| 29 | GW 471558 | 101143375 |
sordarin derivatives
|
472 | E* | eEF2 | E | fungicide | 11600368 | NA | NA | NA | |
| 26 | GW 479821 | 101143570 |
sordarin derivatives
|
552 | E* | eEF2 | E | fungicide | 11600368 | NA | NA | NA | |
| 27 | GW 515716 | 101143571 |
sordarin derivatives
|
486 | E* | eEF2 | E | fungicide | 11600368 | NA | NA | NA | |
| 28 | GW 570009 | 101143572 |
sordarin derivatives
|
484 | E* | eEF2 | E | fungicide | 11600368 | NA | NA | NA | |
| 32 | GW 587270 | 132472117 |
sordarin derivatives
|
506 | E* | eEF2 | E | fungicide | 11600368 | NA | NA | NA | |
| 13 | 470278 |
sesquiterpene
|
295 | E | eIF4A | I |
inhibits eIF4A ATP-activity
|
NA | 28757063 | NA | NA | NA | |
| 137 | elisabatin A | 397069 |
sesquiterpene
|
310 | E | eIF4A | I |
inhibits eIF4A ATP-activity
|
NA | 28757063 | NA | NA | NA |
| 33 | hippuristanol | 9981822 | steroid | 463 | E | eIF4A | I |
inhibits eIF4A; allosteric inhibitor; blocks eIF4AI in a closed state,
preventing its transition to the open state required for eIF4AI's helicase
activity
|
exhibits antiviral activity, potential anticancer drug
|
27335721 | NA | NA | NA |
| 34 | fusidic acid | 3000226 | steroid | 516 | BA(E) | (eEF2) | E |
inhibits GTP-eEF2-dependent
translocation? (probably, nonspecific)
|
NA | 171159 | from 40$ |
1Q23, 1QCA, 2VUF, 4V5F, 4V5M, 4V5N, 4V7B, 4V8U, 4V9L, 4V9M, 4W29, 4WQF,
5JMN, 6Q4N, 6Q4O, 6Q4P
|
|
| 139 | 5251303 |
polyketide-sesquiterpene
|
312 | E | eEF2 | NA | fungicide | 31042251 | NA | NA | NA | ||
| 11 | febrifugine | 115723 |
quinazolinone alkaloid
|
301 | NA |
Pro-tRNA synthetase
|
E |
inhibitor of Pro-tRNA synthetase
|
NA | 22327401 | NA | from 235$ | NA |
| 12 | halofuginone | 400772 | 415 | NA |
Pro-tRNA synthetase
|
E |
inhibitor of Pro-tRNA synthetase
|
anti-inflammatory and antiprotozoal agent
|
22327401 | NA | from 106$ |
4HVC, 4K88, 4OLF, 4Q15, 4YDQ, 5F9Z, 5XIO, 5XIP, 5XIQ, 5ZNJ, 6MN8, 6UYH
|
|
| 98 | 439647 |
chloromethyl ketone
|
352 | BAE? | eEF1A? | E |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP
hydrolysis
[binds to bacterial Ef-Tu and inhibits binding activity for Aa-tRNA] |
NA | [DOI] | NA | from 41$ | NA | |
| 53 | bouvardin | 429598 | 773 | E | eEF2 | E |
blocks eEF2 dissociation from the ribosome
|
NA | NA | NA | NA | ||
| 47 | 13361282 |
cyclic peptides, bouvardin groups
|
757 | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | from 566$ | NA | |
| 44 | 125769 |
cyclic peptides, bouvardin groups
|
787 | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | NA | NA | |
| 45 | RA I | 14390137 |
cyclic peptides, bouvardin groups
|
773 | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | NA | NA |
| 46 | RA II | NA |
cyclic peptides, bouvardin groups
|
NA | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
SMILES:
O=C1[C@H]2CC(C=C3)=CC=C3CC4=C(C)C=CC(C[C@H](C(N[C@H](C)C(N[C@H](C)C(N(C)[C@@H](C(N[C@H](C)C(N2C)=C)=O)CC5=CC=CC=C5)=O)=O)=O)N1C)=C4
|
7922127 | NA | NA | NA |
| 43 | RA III | 14390141 |
cyclic peptides, bouvardin groups
|
787 | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | NA | NA |
| 52 | RA IV | NA |
cyclic peptides, bouvardin groups
|
NA | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
SMILES:
O=C1[C@H]2CC(C=C3)=CC=C3CC4=C(C)C=CC([C@H](O)[C@H](C(N[C@H](C)C(N[C@H](C)C(N(C)[C@@H](C(N[C@H](C)C(N2C)=C)=O)CC5=CC=C(C)C=C5)=O)=O)=O)N1C)=C4
|
7922127 | NA | NA | NA |
| 48 | 13361282 |
cyclic peptides, bouvardin groups
|
757 | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | from 566$ | NA | |
| NA | RA VI | NA |
cyclic peptides, bouvardin groups
|
NA | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | ? | NA |
| 50 | RA VII | 3034401 |
cyclic peptides, bouvardin groups
|
771 | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | from 566$ | NA |
| 51 | RA VIII | 101450177 |
cyclic peptides, bouvardin groups
|
801 | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | NA | NA |
| NA | RA IX | NA |
cyclic peptides, bouvardin groups
|
NA | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | ? | NA |
| 55 | RA X | 6444175 |
cyclic peptides, bouvardin groups
|
829 | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | NA | NA |
| 42 | RA XI | 131676023 |
cyclic peptides, bouvardin groups
|
815 | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | NA | NA |
| 40 | RA XII | 14033269 |
cyclic peptides, bouvardin groups
|
919 | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | from 237$ | NA |
| 41 | RA XIII | 60208884 |
cyclic peptides, bouvardin groups
|
977 | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | NA | NA |
| NA | RA XIV | NA |
cyclic peptides,
bouvardin groups
|
NA | E? | eEF2? | E |
blocks eEF2 dissociation from the ribosome?
|
NA | 7922127 | NA | ? | NA |
| 49 | SVC112 | 10055891 | NA | E? | eEF2? | NA | NA | 31911553 | NA | NA | NA | ||
| 23 | GM193663 | 477019 |
cyclic diterpene glycoside, sordarin analog
|
503 | E* | eEF2 | E |
fungicide, no effect on mammals
|
NA | NA | NA | ||
| 31 | 49867325 |
cyclic diterpene glycoside, sordarin analog
|
691 | E* | eEF2 | E | fungicide | NA | NA | 2NPF | |||
| 25 | GR135402 | 6444409 |
cyclic diterpene glycoside, sordarin analog
|
601 | E* | eEF2 | E |
fungicide, no effect on mammals
|
NA | NA | NA | ||
| 39 | 9812534 |
cyclic peptide
|
1110 | E | eEF1A | E |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis
|
anti-cancer agent
|
27713531 | USA 7, EU 8 | NA | 5LZS | |
| 38 | didemnin B | 122651 |
cyclic peptide
|
1112 | E | eEF1A | E |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis
|
does not inhibit the delivery of aminoacyl-tRNA
|
NA | NA | 5LZS | |
| 54 | 122204196 |
cyclic peptide
|
817 | E | eEF1A | E |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis
|
NA | NA | NA | NA | ||
| 37 | 11073155 |
cyclic peptide
|
1056 | E | eEF1A | E |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis
|
NA | NA | NA | 5LZS | ||
| 36 | 10724794 |
cyclic peptide
|
1042 | E | eEF1A | E |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis
|
NA | NA | NA | 5LZS | ||
| 108 | cytotrienin A | 11966097 |
cyclic peptide
|
649 | E | eEF1A | E |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis
|
causes ribotoxic stress
|
20943818 | NA | NA | NA |
| 104 | 5282069 |
cyclic peptide, ansamycin
|
637 | E* | eEF1A | E? |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis
|
NA | 21448188 | NA | NA | NA | |
| 107 | 6447675 |
cyclic peptide, ansamycin
|
639 | E | eEF1A | E |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis
|
NA | NA | from 468$ | NA | ||
| 8 | 70681187 |
cyclic peptide, ansamycin
|
NA | NA | eEF1A? | NA |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis?
|
a novel analogue of trienomycin; anticancer activity
|
22162786 | NA | NA | NA | |
| 103 | 6438814 |
cyclic peptide, ansamycin
|
623 | E | eEF1A? | E |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis
|
NA | NA | NA | NA | ||
| 102 | 139590120 |
cyclic peptide, ansamycin
|
NA | NA | NA | NA |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis?
|
a novel analogue of trienomycin; anticancer activity
|
30132670 | NA | NA | NA | |
| 101 | 139590121 |
cyclic peptide, ansamycin
|
NA | NA | NA | NA |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis?
|
a novel analogue of trienomycin; anticancer activity
|
30132670 | NA | NA | NA | |
| 100 | 139590122 |
cyclic peptide, ansamycin
|
NA | NA | NA | NA |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis?
|
a novel analogue of trienomycin; anticancer activity
|
30132670 | NA | NA | NA | |
| 106 | trierixin | 24180439 |
cyclic peptide, ansamycin
|
685 | E | eEF1A? | E |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis
|
NA | NA | NA | NA | |
| 105 | 102596141 |
cyclic peptide, ansamycin
|
683 | E | eEF1A? | E |
stabilize eEF1A comples with Aa-tRNA on a ribosome after GTP hydrolysis
|
NA | NA | NA | NA | ||
| 57 | 4E1RCat | 78357788 | NA | 479 | E | eIF4E-eIF4G | I |
binds to the initiator factor eIF4E and inhibits the formation of a complex
with eIF4G
|
NA | 21191102 | NA | from 48$ | NA |
| 56 | 4E2RCat | 2287236 | NA | 456 | E | eIF4E-eIF4G | I |
binds to the initiator factor eIF4E and inhibits the formation of a complex
with eIF4G
|
NA | 21507972 | NA | from 155$ | NA |
| 109 | 4EGI-1 | 5717952 | NA | 451 | E | eIF4E-eIF4G | I |
binds to the initiator factor eIF4E and inhibits the formation of a complex
with eIF4G
|
NA | 17254965 | NA | from 56$ | NA |
| 71 | rocaglamide | 331783 | NA | 506 | E | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA, inhibiting the eIF4A
helicase activity
|
NA | NA | from 235$ | 5ZC9 | |
| 87 | WDG57-591 | NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=C2C(O[C@]3(C4=CC=C(OC)C=C4)[C@@]2(O)[C@H](O)[C@H](C(N(C)OC)=O)[C@H]3C5=CC=CC=C5)=CC(OC6O[C@@H]([C@@H](CO)O)CO[C@H]6OC)=C1
|
30504817 | NA | NA | NA |
| 92 |
CMLD012073
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC(=O)[C@@H]1[C@@H](C2=CC=CC=C2)[C@@]2(OC3=CC(OC)=CC(OC)=C3[C@@]22NC(C)=N[C@@]12O)C1=CC=C(OC)C=C1
|
30504817 | NA | NA | NA |
| 77 | SDS-1-0-21 | NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
CONC(=O)[C@H]1[C@@H](O)[C@@]2(O)C3=C(O[C@]2([C@@H]1C1=CC=CC=C1)C1=CC=C(Br)C=C1)C=C(OC)C=C3OC
|
30504817 | NA | NA | NA |
| 85 | WDG57-590 | NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=C2C(O[C@]3(C4=CC=C(OC)C=C4)[C@@]2(O)[C@H](O)[C@H](C(NOC)=O)[C@H]3C5=CC=CC=C5)=CC(OC6O[C@@H]([C@@H](CO)O)CO[C@H]6OC)=C1
|
30504817 | NA | NA | NA |
| 78 |
CMLD010510
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=C2C(O[C@]3(C4=CC=C(Br)C=C4)[C@@]2(O)[C@H](O)[C@H](C(N(C)OC)=O)[C@H]3C5=CC=CC=C5)=CC(OC)=C1
|
30504817 | NA | NA | NA |
| 91 |
CMLD012072
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC(=O)[C@@H]1[C@@H](C2=CC=CC=C2)[C@@]2(OC3=CC(OC)=CC(OC)=C3[C@@]22NC(=N[C@@]12O)C1CC1)C1=CC=C(OC)C=C1
|
30504817 | NA | NA | NA |
| 63 |
CMLD012150
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC(=O)[C@@H]1[C@@H](C2=CC=CC=C2)[C@@]2(OC3=CC(OC)=CC(OC)=C3[C@@]22NC(=N[C@@]12O)C1=CSC(C)=N1)C1=CC=C(OC)C=C1
|
30504817 | NA | NA | NA |
| 90 |
CMLD012118
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC(=O)[C@@H]1[C@@H](C2=CC=CC=C2)[C@@]2(OC3=CC(OC)=CC(OC)=C3[C@@]22NC(=N[C@@]12O)N1CCOCC1)C1=CC=C(OC)C=C1
|
30504817 | NA | NA | NA |
| 120 |
BUCMD00209
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=CC2=C(C(OC)=C1)[C@]1(O)C3=C([C@@H](C4=CC=CC=C4)[C@@]1(O2)C1=CC=C(Br)C=C1)C(=O)N1CCC[C@H]1N3
|
30504817 | NA | NA | NA |
| 116 |
BUCMD00211
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=CC2=C(C(OC)=C1)[C@]1(O)C3=C([C@@H](C4=CC=CC=C4)[C@@]1(O2)C1=CC=C(Br)C=C1)C(=O)N1CCC[C@H]1O3
|
30504817 | NA | NA | NA |
| 79 |
CMLD010511
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=C2C(O[C@]3(C4=CC=C(Br)C=C4)[C@@]2(O)[C@H](O)[C@H](C(OC)=O)[C@H]3C5=CC=CC=C5)=CC(OC)=C1
|
30504817 | NA | NA | NA |
| 73 |
CMLD010513
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=C2C(O[C@]3(C4=CC=C(OC)C=C4)[C@@]2(O)[C@H](O)[C@H](C(NOC)=O)[C@H]3C5=CC=CC=C5)=CC(OC)=C1
|
30504817 | NA | from 998$ | 5ZC9 |
| 115 |
CMLD012108
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=CC=C(C=C1)[C@@]12OC3=CC(OC)=CC(OC)=C3[C@]1(O)C1=C([C@H]2C2=CC=CC=C2)C(=O)N2CCC[C@H]2N1CCN(C)C
|
30504817 | NA | NA | NA |
| 62 |
CMLD012151
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC(=O)[C@@H]1[C@@H](C2=CC=CC=C2)[C@@]2(OC3=CC(OC)=CC(OC)=C3[C@@]22NC(=N[C@@]12O)C1=CC=C(OC)C=C1)C1=CC=C(OC)C=C1
|
30504817 | NA | NA | NA |
| 74 | RHT | NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=C2C(O[C@]3(C4=CC=C(OC)C=C4)[C@@]2(O)[C@H](O)[C@H](C(N(C)OC)=O)[C@H]3C5=CC=CC=C5)=CC(OC)=C1
|
30504817 | NA | NA | 5ZC9 |
| 89 |
CMLD010514
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
[H]O[C@@H]1[C@@H]([C@@H](C2=CC=CC=C2)[C@@]2(OC3=CC(OC)=CC(OC)=C3[C@]12O[H])C1=CC=C(OC)C=C1)C(=O)N([H])OCCOCCOCCN=[N+]=[N-]
|
30504817 | NA | NA | NA |
| 61 |
CMLD012152
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC(=O)[C@@H]1[C@@H](C2=CC=CC=C2)[C@@]2(OC3=CC(OC)=CC(OC)=C3[C@@]22NC(=N[C@@]12O)C1=CC=CN=C1)C1=CC=C(OC)C=C1
|
30504817 | NA | NA | NA |
| 75 | CR-1-31-b | NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
CONC(=O)[C@H]1[C@@H](O)[C@@]2(O)C3=C(O[C@]2([C@@H]1C1=CC=CC=C1)C1=CC=C(OC)C=C1)C=C(OC)C=C3OC
|
30504817 | NA | from 998$ | NA |
| 123 |
CMLD010482
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=CC(F)=CC2=C1[C@]1(O)C3=C([C@@H](C4=CC=CC=C4)[C@@]1(O2)C1=CC=C(Br)C=C1)C(=O)N1CCC[C@@]1(C)N3
|
30504817 | NA | NA | NA |
| 59 |
CMLD011410
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
O[C@@]12[C@@]([C@H](C3=CC=CC=C3)[C@@H](C(C4=C(OC)C=CC=C4)=O)[C@H]2O)(C5=CC=C(OC)C=C5)OC6=CC(OC)=CC(OC)=C61
|
30504817 | NA | NA | NA |
| 80 |
CMLD010335
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
CONC(=O)[C@H]1[C@@H](O)[C@@]2(O)C3=C(O[C@]2([C@@H]1C1=CC=CC=C1)C1=CC=C(Br)C=C1)C=C(F)C=C3OC
|
30504817 | NA | NA | 5ZC9 |
| 117 |
CMLD010535
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
[H]OC12C3=C([C@@H](C4=CC=CC=C4)[C@@]1(OC1=CC(OC)=CC(OC)=C21)C1=CC=C(OC)C=C1)C(=O)N1CCC[C@@]1([H])O3
|
30504817 | NA | NA | NA |
| 58 |
CMLD011408
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
O[C@@]12[C@@]([C@H](C3=CC=CC=C3)[C@@H](C(C4=CC5=C(C=CC=C5)O4)=O)[C@H]2O)(C6=CC=C(OC)C=C6)OC7=CC(OC)=CC(OC)=C71
|
30504817 | NA | NA | NA |
| 121 |
CMLD010503
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=CC=C(C=C1)[C@@]12OC3=CC(OC)=CC(OC)=C3[C@]1(O)C1=C([C@H]2C2=CC=CC=C2)C(=O)N2CCC[C@H]2N1
|
30504817 | NA | NA | NA |
| 66 |
CMLD010536
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=CC=C(C=C1)[C@@]12OC3=CC(OC)=CC(OC)=C3[C@]1(O)[C@H](O)[C@@H]([C@H]2C1=CC=CC=C1)C(=O)C1=CC=CO1
|
30504817 | NA | NA | NA |
| 65 |
CMLD011404
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
O[C@@]12[C@@]([C@H](C3=CC=CC=C3)[C@@H](C(C4=CC=C(C)O4)=O)[C@H]2O)(C5=CC=C(OC)C=C5)OC6=CC(OC)=CC(OC)=C61
|
30504817 | NA | NA | NA |
| 72 |
CMLD005522
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=C2C(O[C@]3(C4=CC=C(OC)C=C4)[C@@]2(O)[C@H](O)[C@H](C(NOC)=O)[C@H]3C5=CC=CC=C5)=CC(OC)=C1
|
30504817 | NA | from 998$ | NA |
| 82 |
BUCMD00003
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
CONC(=O)[C@H]1[C@@H](O)[C@@]2(O)C3=C(O[C@]2([C@@H]1C1=CC=CC=C1)C1=CC=C(Br)C=C1)C=C(O)C=C3OC
|
30504817 | NA | NA | NA |
| 88 |
CMLD010512
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
[H]O[C@@H]1[C@@H]([C@@H](C2=CC=CC=C2)[C@@]2(OC3=CC(OC)=CC(OC)=C3[C@]12O[H])C1=CC=C(OC)C=C1)C(=O)N([H])CCCC(OC)OC
|
30504817 | NA | NA | 5ZC9 |
| 118 |
BUCMD00210
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=CC2=C(C(OC)=C1)[C@]1(O)C3=C([C@@H](C4=CC=CC=C4)[C@@]1(O2)C1=CC=C(Br)C=C1)C(=O)N1CCC[C@@H]1N3
|
30504817 | NA | NA | NA |
| 83 |
CMLD010338
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=C2C(O[C@]3([C@@H]([C@H]([C@@H](O)[C@@]23O)C2=NOC(C)=N2)C2=CC=CC=C2)C2=CC=C(Br)C=C2)=CC(F)=C1
|
30504817 | NA | NA | NA |
| 95 |
CMLD011886
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=CC=C(C=C1)[C@@]12OC3=CC(OC)=CC(OC)=C3[C@]1(O)[C@H](O)[C@@H]([C@H]2C1=CC=CC=C1)C(O)=O
|
30504817 | NA | from 446$ | NA |
| 60 |
CMLD012075
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC(=O)[C@@H]1[C@@H](C2=CC=CC=C2)[C@@]2(OC3=CC(OC)=CC(OC)=C3[C@@]22NC(=N[C@@]12O)C1=CC=CC=C1)C1=CC=C(OC)C=C1
|
30504817 | NA | NA | NA |
| 68 |
CMLD012049
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=CC=C(C=C1)[C@@]12OC3=CC(OC)=CC(OC)=C3[C@]1(O)[C@@H](O)[C@@H]([C@H]2C1=CC=CC=C1)C(=O)C1=CC=CO1
|
30504817 | NA | NA | NA |
| 122 |
CMLD011353
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
[H][C@@]12CCCN1C(=O)C1=C(N2)[C@@]2(O)C3=C(C[C@]2([C@@H]1C1=CC=CC=C1)C1=CC=C(Br)C=C1)C=C(F)C=C3OC
|
30504817 | NA | NA | NA |
| 69 |
CMLD012187
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=CC=C(C=C1)[C@@]12OC3=CC(OC)=CC(OC)=C3[C@]1(O)[C@H](O)[C@@H]([C@H]2C1=CC=CC=C1OC)C(=O)C1=CC=CO1
|
30504817 | NA | NA | NA |
| 125 |
CMLD009433
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=C2C(O[C@]3(C4=CC=C(OC)C=C4)[C@@]2(O)C5=C(C(O)=NN5)[C@H]3C6=CC=CC=C6)=CC(OC)=C1
|
30504817 | NA | NA | NA |
| 93 |
CMLD010500
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=C2C(O[C@]3(C4=CC=C(Br)C=C4)[C@@]2(O)[C@H]5[C@H](C(O5)=O)[C@H]3C6=CC=CC=C6)=CC(OC)=C1
|
30504817 | NA | NA | NA |
| 119 |
CMLD012107
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=CC=C(C=C1)[C@@]12OC3=CC(OC)=CC(OC)=C3[C@]1(O)C1=C([C@H]2C2=CC=CC=C2)C(=O)N2CCC[C@H]2N1C
|
30504817 | NA | NA | NA |
| 64 |
CMLD011406
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
O[C@@]12[C@@]([C@H](C3=CC=CC=C3)[C@@H](C(C4=CC=C(CCC)O4)=O)[C@H]2O)(C5=CC=C(OC)C=C5)OC6=CC(OC)=CC(OC)=C61
|
30504817 | NA | NA | NA |
| 70 |
CMLD012186
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
CON(C)C(=O)[C@H]1[C@@H](O)[C@@]2(O)C3=C(O[C@]2([C@@H]1C1=CC=CC=C1OC)C1=CC=C(OC)C=C1)C=C(OC)C=C3OC
|
30504817 | NA | NA | 5ZC9 |
| 84 |
CMLD010336
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=C2C(O[C@]3([C@@H]([C@H]([C@@H](O)[C@@]23O)C2=NC(C)=NO2)C2=CC=CC=C2)C2=CC=C(Br)C=C2)=CC(F)=C1
|
30504817 | NA | NA | NA |
| 76 |
CMLD011610 (RHT)
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
CON(C)C(=O)[C@H]1[C@@H](O)[C@@]2(O)C3=C(O[C@]2([C@@H]1C1=CC=CC=C1)C1=CC=C(OC)C=C1)C=C(OC)C=C3OC
|
30504817 | NA | NA | 5ZC9 |
| 81 |
CMLD011891
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC(=O)[C@H]1[C@@H](O)[C@@]2(O)C3=C(O[C@]2([C@@H]1C1=CC=CC=C1)C1=CC=C(Br)C=C1)C=C(O)C=C3OC
|
30504817 | NA | NA | NA |
| 94 |
CMLD011885
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=CC=C(C=C1)[C@@]12OC3=CC(OC)=CC(OC)=C3[C@]1(O)[C@H](O)[C@@H]([C@H]2C1=CC=CC=C1)C(O)=O
|
30504817 | NA | from 446$ | NA |
| 96 | FL3 | NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=CC2=C(C(OC)=C1)[C@]1(O)[C@H](O)C[C@@H](C3=CC=CC=C3)[C@@]1(O2)C1=CC=C(Br)C=C1
|
30504817 | NA | NA | NA |
| 67 |
CMLD011407
|
NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
O[C@@]12[C@@]([C@H](C3=CC=CC=C3)[C@@H](C(C4=NC=CN4C)=O)[C@H]2O)(C5=CC=C(OC)C=C5)OC6=CC(OC)=CC(OC)=C61
|
30504817 | NA | NA | NA |
| 124 | NA | rocaglates | NA | E? | eIF4A | I |
inhibits eIF4A; stabilizes the eIF4A complex with RNA?
|
SMILES:
COC1=C2C(O[C@]3(C4=CC=C(OC)C=C4)[C@@]2(O)C5=C(C(O)=NN5)[C@H]3C6=CC=CC=C6)=CC(OC)=C1
|
30504817 | NA | NA | NA | |
| 86 | silvestrol | 11787114 | rocaglates | 655 | E | eIF4A | I |
inhibits eIF4A helicase activity
|
NA | NA | from 987$ | NA | |
| 6 |
GC7 / N1–guanyl–1,7–diaminoheptane
|
448393 |
spermidine analog
|
172 | BAE | DHPS/eIF5A | I |
inhibitor of deoxyhypusine synthase (DHPS), which necessary for the
synthesis of hypusine and posttranslational modification of eIF5A
|
NA | 25218134 | NA | NA | NA |
| 113 |
CNI1493 / semapimod
|
5745214 | anilide | 745 | E | DHPS/eIF5A | E |
inhibitor of deoxyhypusine synthase (DHPS), which necessary for the
synthesis of hypusine and posttranslational modification of eIF5A
|
anti-inflammatory, antimalarial drug
|
18256853 | USA 4 | NA | NA |
| 7 |
deoxyspergualin / gusperimus
|
55362 |
N-acil-aminoacid
|
388 | E | DHPS/eIF5A | E |
inhibitor of deoxyhypusine synthase (DHPS), which necessary for the
synthesis of hypusine and posttranslational modification of eIF5A
|
NA | 11964177 | USA 4, EU 2 | NA | NA |
| NA | DHSI-15 | NA | NA | NA | E | DHPS/eIF5A | E |
inhibitor of deoxyhypusine synthase (DHPS), which necessary for the
synthesis of hypusine and posttranslational modification of eIF5A
|
NA | 22415796 | NA | ? | NA |
| 5 |
ciclopirox / loprox
|
2749 |
pyridone derivative
|
207 | E | DOHH/eIF5A | E |
inhibitor of the synthesis of hypusin which is nessary for the operation of
eIF5A (iron chelator)
|
NA | from 26$ | NA | ||
| 16 | deferiprone | 2972 |
pyridone derivative
|
139 | E | DOHH/eIF5A | E |
inhibitor of the synthesis of hypusin which is nessary for the operation of
eIF5A (iron chelator)
|
NA | from 12$ | NA | ||
| 14 | mimosine | 3862 |
pyridone derivative
|
198 | E | DOHH/eIF5A | E |
inhibitor of the synthesis of hypusin which is nessary for the operation of
eIF5A (iron chelator)
|
NA | 30208826 | NA | from 30$ | NA |
| NA | CC-885 | 24788636 | ? | 440.9 | E | eRF3 | T | cereblon E3 ligase modulator, targets GSPT1/2 for degradation | 27338790 | NA | ? | 5HXB | |
| NA | CC-90009 | 118647211 | ? | 461.8 | E | eRF3 | T | cereblon E3 ligase modulator, targets GSPT1/2 for degradation | aka eragidomide | 33197925 33764477 |
NA | ? | 6XK9 |
| NA | i14G1-10 | - | ? | ? | E | eIF4G1 | I | Binds eIF4G1 and mimic eIF1 and eIF4G1 perturbations on the stringency of start codon selection | 35857873 | NA | ? | NA | |
| NA | i14G1-12 | - | ? | ? | E | eIF4G1 | I | Binds eIF4G1 and mimic eIF1 and eIF4G1 perturbations on the stringency of start codon selection | 35857873 | NA | ? | NA | |
| NA | zotatifin/eFT226 | 129138801 | rocaglate | 487.5 | E | eIF4A | I | a sequence-selective inhibitor of eIF4A-mediated translation | 32470302 35805935 |
USA 2 | ? | NA | |
| NA | CMLD012612 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | 31519508 | NA | ? | NA | |
| NA | BUCMD00254 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010332 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010423 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010425 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010426 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010428 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010430 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010502 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010506 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010507 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010518 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010528 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010584 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010852 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010853 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD010855 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011166 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011167 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011352 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011353 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011702 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011833 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011840 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011842 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011849 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011850 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011865 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011866 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011871 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011876 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011877 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011878 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011879 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011888 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011889 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD011929 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD012042 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD012045 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD012046 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD012047 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD012050 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD012051 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD012070 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD012077 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | CMLD012100 | - | amidino-rocaglate | ? | E? | eIF4A | I | inhibitor of eIF4A-mediated translation | No direct evidence of protein synthesis inhibition; assumption is made upon the ability to bind eIF4A (more effectively than silvestrol for both 4A1 and 4A2) | 31519508 | NA | ? | NA |
| NA | SR-A3 | NA | cyclic heptapeptide | ? | E? | eEF1A | E | stabilizes eEF1A comples with Aa-tRNA on a ribosome before or after GTP hydrolysis | Ternatin family | 36123449 | NA | ? | NA |
| NA | SS-A3 | NA | cyclic heptapeptide | ? | E? | eEF1A | E | stabilizes eEF1A comples with Aa-tRNA on a ribosome before or after GTP hydrolysis | Ternatin family | 36123449 | NA | ? | NA |
| SC | Name | Pubchem CIDs |
Class, group of chemical compounds | MW | Target | Stage affected (IETR) |
Mechanism of action | Comments | References | Clinical trials | Cost and Vendors | PDB structures |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 4 | rapamycin / sirolimus | 5284616 | macrolide | 914 |
mTORC1 (FKBP12)
|
I, (E) |
allosteric mTOR inhibitor (mTORC1 only); 4E-BP1 activation and suppression
of cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 12742462 | from 30$ |
1C9H, 1FAP, 1FKB, 1FKL, 1NSG, 1PBK, 1Z58, 2DG3, 2DG4, 2DG9, 2FAP, 2VCD,
3KZ7, 4DH0, 4DRH, 4DRI, 4DRJ, 4QT2, 4QT3, 5FLC, 5GPG, 5HKG, 6L3A, 6M4U, 6M4V,
6M4W
|
|
| 7 | everolimus | 6442177 |
macrolide, synthetic analog of rapamycin
|
958 |
mTORC1 (FKBP12)
|
I, (E) |
allosteric mTOR inhibitor (mTORC1 only); 4E-BP1 activation and suppression
of cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 19860903 | from 50$ |
1C9H, 1FAP, 1FKB, 1FKL, 1NSG, 1PBK, 1Z58, 2DG3, 2DG4, 2DG9, 2FAP, 2VCD,
3KZ7, 4DH0, 4DRH, 4DRI, 4DRJ, 4QT2, 4QT3, 5FLC, 5GPG, 5HKG, 6L3A, 6M4U, 6M4V,
6M4W
|
|
| 6 | temsirolimus | 6918289 |
macrolide, synthetic analog of rapamycin
|
1030 |
mTORC1 (FKBP12)
|
I, (E) |
allosteric mTOR inhibitor (mTORC1 only); 4E-BP1 activation and suppression
of cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 19860903 | from 75$ |
1C9H, 1FAP, 1FKB, 1FKL, 1NSG, 1PBK, 1Z58, 2DG3, 2DG4, 2DG9, 2FAP, 2VCD,
3KZ7, 4DH0, 4DRH, 4DRI, 4DRJ, 4QT2, 4QT3, 5FLC, 5GPG, 5HKG, 6L3A, 6M4U, 6M4V,
6M4W
|
|
| 5 | ridaforolimus | 11520894 |
macrolide, synthetic analog of rapamycin
|
990 |
mTORC1 (FKBP12)
|
I, (E) |
allosteric mTOR inhibitor (mTORC1 only); 4E-BP1 activation and suppression
of cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 19860903 | from 54$ |
1C9H, 1FAP, 1FKB, 1FKL, 1NSG, 1PBK, 1Z58, 2DG3, 2DG4, 2DG9, 2FAP, 2VCD,
3KZ7, 4DRH, 4DRI, 4DRJ, 4QT2, 4QT3, 5FLC, 5GPG, 5HKG, 6M4U, 6M4V, 6M4W
|
|
| 28 | torin-1 | 49836027 |
pyridinonequinoline
|
608 | _mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 19150980 | NA | from 50$ | NA |
| 26 | torin-2 | 51358113 |
pyridinonequinoline
|
432 | _mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 23436801 | NA | from 45$ | 4JSX |
| 15 | PP242 / torkinib | 135565635 |
pyrazolopyrimidine
|
308 | _mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 20686120 | NA | from 41$ | 4JT5 |
| 14 | MLN0128 / INK128 / TAK-228 / sapanisertib | 45375953 | benzoxazole | 309 | _mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | from 39$ | 6GVF, 6GVI | ||
| 20 | AZD2014 / vistusertib | 25262792 |
phenylpyridine
|
463 | _mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 23375793 | from 41$ | NA | |
| 19 | AZD8055 | 25262965 |
phenylpyridine, vistusertib analog
|
466 | _mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 23375793 | from 40$ | NA | |
| 27 | NVP-BEZ235 / dactolisib | 11977753 |
phenylquinoline
|
470 | PI3K/mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 18606717 | from 40$ | NA | |
| 16 | voxtalisib / SAR245409 / XL765 | 16123056 |
pyrazolylpyridine
|
270 | PI3K/mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 24634413 | USA 6, EU 3 | from 50$ | NA |
| 21 | LY3023414 / samotosilib | 57519748 |
imidazoquinoline
|
407 | PI3K/mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 27439478 | from 77$ | NA | |
| 18 | wortmannin | 312145 | steroid | 428 | PI3K/mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 8895571 | NA | from 55$ |
1E7U, 3D5X, 3HHM
|
| 31 | LY294002 | 3973 |
morpholine derivative
|
307 | PI3K/mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 8895571 | NA | from 30$ |
1E7V, 1YI3, 4AZT, 4CFK, 6G0D
|
| 11 | PQR309 / bimiralisib | 58507717 | pyridinamine | 411 | PI3K/mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 29066507 | USA 8, EU 5 | from 45$ |
5JHB, 5OQ4, 6OAC
|
| 12 | gedatolisib / PKI-587 / PF05212384 | 44516953 |
benzoylpiperidine
|
616 | PI3K/mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 20166697 | from 48$ | NA | |
| 25 | GSK2126458 / omipalisib | 25167777 | quinoline | 506 | PI3K/mTOR | I, (E) |
ATP-competitive mTOR inhibitor; 4E-BP1 activation and suppression of
cap-dependent translation, primarily 5'-TOP mRNA
|
NA | 24900173 | USA 3 | from 56$ | 3L08 |
| 30 | МK1775 / adavosertib | 24856436 | piperazine | 501 | GCN2? | I |
GCN2 activator?, suppresses translation of 5’-TOP mRNA
|
NA | 30224479 | from 35$ |
5V5Y, 5VD0, 5VD4, 5VD5, 5VD7, 5VD8, 5VD9, 5VDA, 5VDK
|
|
| 23 | dabrafenib | 44462760 | sulfanilide | 520 | GCN2? | I |
GCN2 activator?, suppresses translation of 5’-TOP mRNA
|
NA | 30224479 | from 50$ |
4XV2, 5CSW, 5HIE, 6HJ2
|
|
| 13 | BTdCPU | 49787174 |
N,N'-diarylurea
|
339 | HRI | I |
activator of HRI - kinase of initiation factor elF2; it leads to eIF2
inactivation
|
NA | 21765405 | NA | from 113$ | NA |
| 29 | CCT020312 | 3108148 | quinoline | 650 | PERK | I |
activator of PERK - kinase of initiation factor elF2; it leads to eIF2
inactivation
|
NA | 22253692 | NA | from 188$ | NA |
| 10 | MK-28 | 44265590 |
methylaminopentanamide
|
317 | PERK | I |
activator of PERK - kinase of initiation factor elF2; it leads to eIF2
inactivation
|
NA | 32327686 | NA | NA | NA |
| 32 | salubrinal | 5717801 | 480 |
GADD34/PP1, CReP/PP1
|
I |
inhibitor of eIF2-specific PP1 phosphatase complexes (GADD34/P1, CReP/P1),
it leads to inactivation of eIF2
|
NA | 15705855 | NA | from 30$ | NA | |
| 33 | Sal003 | 5717737 | 462 |
GADD34/PP1, CReP/PP1
|
I |
inhibitor of eIF2-specific PP1 phosphatase complexes (GADD34/P1, CReP/P1),
it leads to inactivation of eIF2
|
NA | 17418795 | NA | from 30$ | NA | |
| 9 | ISRIB | 1011240 |
cyclohexylacetamide
|
451 | eIF2B | I |
eIF2B activity modulator; prevent translation inhibition
|
NA | NA | from 25$ |
6CAJ, 6EZO, 6O81, 6O85
|
|
| 2 | myriaporone 3 | 71306325 |
polyketide, tedanolide group
|
373 | eEF2K? | E |
binds to eEF2K and induces phosphorylation and inactivation of eEF2
|
23303710 | NA | NA | NA | |
| 3 | myriaporone 4 | 100917959 |
polyketide, tedanolide group
|
373 | eEF2K? | E |
binds to eEF2K and induces phosphorylation and inactivation of eEF2
|
23303710 | NA | NA | NA | |
| 8 | NH125 | 10436839 |
methylimidazolium iodide
|
525 | eEF2K? | E |
eEF2 phosphorylation inductor
|
it was initially assumed to be an eEF2K inhibitor
|
NA | from 34$ | NA | |
| 17 | A-484954 | 14998470 |
pyrimidine-6-carboxamide
|
289 | eEF2K | E |
inhibitor of eEF2K; prevent translation inhibition
|
NA | 22020937 | NA | from 41$ | NA |
| 1 | 65110 |
ribonucleotide
|
338 | AMPK | E |
AMPK activator; activates AMPK without changing the levels of the
nucleotides
|
NA | 7926017 | NA | from 41$ |
1M9N, 1P4R, 1PL0, 2CNQ, 2NTL, 2QRE, 2R7K, 2R7L, 2R7N, 2R84, 2UV5, 4A1O,
4TX9, 4XW7, 4XWF, 4ZNP, 5BTP, 5DN1, 5NXA, 5PZW, 5UY8, 5UZ0, 6OD9
|
|
| 22 | A-769662 | 54708532 | NA | 360 | AMPK | E |
AMPK activator; activates AMPK by mimicking both effects of AMP, i.e.
allosteric activation and inhibition of dephosphorylation
|
NA | 17855357 | NA | from 34$ | 4CFF |
| 24 | "991" | 45256693 |
benzimidazole derivative
|
432 | AMPK | E |
AMPK activator;
|
also enhances AMPK activity in combination with AICAR
|
27577855 | NA | from 50$ | 4CFE, 5ISO |